|
|
| | (+/-)-COTININE-D3 Basic information |
| | (+/-)-COTININE-D3 Chemical Properties |
| Melting point | 40-42 °C(lit.) | | Boiling point | 250 °C150 mm Hg(lit.) | | Fp | 9℃ | | storage temp. | 2-8°C | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | (Colorless to yellow) &_& (viscous liquid or solid) | | color | Off-White to Brown | | Stability: | Moisture, Temperature Sensitive - Seal Tightly, Store in Freezer, Hygroscopic | | Major Application | forensics and toxicology | | InChI | 1S/C10H12N2O/c1-12-9(4-5-10(12)13)8-3-2-6-11-7-8/h2-3,6-7,9H,4-5H2,1H3/i1D3 | | InChIKey | UIKROCXWUNQSPJ-FIBGUPNXSA-N | | SMILES | N1(C(CCC1=O)c2cnccc2)C([2H])([2H])[2H] | | EPA Substance Registry System | 2-Pyrrolidinone, 1-(methyl-d3)-5-(3-pyridinyl)- (110952-70-0) | | CAS Number Unlabeled | 486-56-6 |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38 | | Safety Statements | 26 | | RIDADR | UN1230 - class 3 - PG 2 - Methanol, solution | | WGK Germany | 3 | | Storage Class | 3 - Flammable liquids | | Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Flam. Liq. 2 STOT SE 1 |
| | (+/-)-COTININE-D3 Usage And Synthesis |
| Chemical Properties | White Crystalline Solid | | Uses | A labelled major metabolite of nicotine in humans. Carcinogen. | | General Description | Cotinine is an alkaloid found in tobacco as well as a major urinary metabolite of nicotine. This stable-labeled internal standard is suitable for quantitation of cotinine levels in urine, blood, and saliva for GC/MS or LC-MS/MS applications in nicotine testing or clinical and diagnostic testing of nicotine biomarkers. |
| | (+/-)-COTININE-D3 Preparation Products And Raw materials |
|