|
|
| | 1-Acetyl-2-phenylhydrazine Basic information |
| | 1-Acetyl-2-phenylhydrazine Chemical Properties |
| Melting point | 128-131 °C(lit.) | | Boiling point | 271.72°C (rough estimate) | | density | 1.1392 (rough estimate) | | refractive index | 1.6180 (estimate) | | storage temp. | Store at +15°C to +25°C. | | solubility | soluble in Alcohol | | form | powder to crystal | | pka | 12.75±0.23(Predicted) | | color | White to Light yellow to Light orange | | BRN | 742880 | | InChI | InChI=1S/C8H10N2O/c1-7(11)9-10-8-5-3-2-4-6-8/h2-6,10H,1H3,(H,9,11) | | InChIKey | UICBCXONCUFSOI-UHFFFAOYSA-N | | SMILES | C(NNC1=CC=CC=C1)(=O)C | | CAS DataBase Reference | 114-83-0(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Acetyl-1-phenylhydrazine(114-83-0) | | EPA Substance Registry System | .beta.-Acetylphenylhydrazine (114-83-0) |
| Hazard Codes | Xn | | Risk Statements | 22-36/37/38-43-20/21/22 | | Safety Statements | 22-26-36-24/25-36/37 | | RIDADR | UN 2811 6.1/PG 3 | | WGK Germany | 3 | | RTECS | AJ2900000 | | TSCA | TSCA listed | | HazardClass | 6.1 | | PackingGroup | III | | HS Code | 29280090 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral | | Hazardous Substances Data | 114-83-0(Hazardous Substances Data) |
| | 1-Acetyl-2-phenylhydrazine Usage And Synthesis |
| Chemical Properties | white to light yellow crystal powde | | Uses | 1-Acetyl-2-phenylhydrazine is an Anaerobically curable compound. | | Synthesis Reference(s) | The Journal of Organic Chemistry, 30, p. 2486, 1965 DOI: 10.1021/jo01018a525 | | General Description | Colorless prisms or white solid. | | Air & Water Reactions | Water insoluble. | | Reactivity Profile | 1-Acetyl-2-phenylhydrazine is an amide and an amine. Organic amides/imides react with azo and diazo compounds to generate toxic gases. Flammable gases are formed by the reaction of organic amides/imides with strong reducing agents. Amides are very weak bases (weaker than water). Imides are less basic yet and in fact react with strong bases to form salts. That is, they can react as acids. Mixing amides with dehydrating agents such as P2O5 or SOCl2 generates the corresponding nitrile. The combustion of these compounds generates mixed oxides of nitrogen (NOx). | | Health Hazard | ACUTE/CHRONIC HAZARDS: When heated to decomposition 1-Acetyl-2-phenylhydrazine emits toxic fumes. | | Fire Hazard | Flash point data for 1-Acetyl-2-phenylhydrazine are not available. 1-Acetyl-2-phenylhydrazine is probably combustible. | | Biological Activity | 1-Acetyl-2-phenylhydrazine (AcPhHZ) is a vascular tumor initiator used in experimental animal model. | | Purification Methods | Crystallise the hydrazine from aqueous EtOH. [Beilstein 15 H 241.] |
| | 1-Acetyl-2-phenylhydrazine Preparation Products And Raw materials |
|