- Niraparib tosylate
-
-
2026-06-30
- CAS:1613220-15-7
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 10000KGS
|
| Product Name: | Niraparib tosylate | | Synonyms: | MK-4827, Niraparib TsOH salt hydrate;Niraparib tosylate monohyrate;(S)-2-(4-(piperidin-3-yl)phenyl)-2H-indazole-7-carboxamide 4-methylbenzenesulfonate hydrate;Niraparib TsOH salt hydrate;Nilapani toluene monohydrate;Niraparib TOS H2O;Niraparib tosylate hydrate;Niraparib Tosylate Monohydrate (API) | | CAS: | 1613220-15-7 | | MF: | C26H28N4O4S | | MW: | 492.59 | | EINECS: | | | Product Categories: | API;1613220-15-7 | | Mol File: | 1613220-15-7.mol |  |
| | Niraparib tosylate Chemical Properties |
| solubility | DMSO: ~64 mg/mL (~199.8 mM)；Ethanol: ~64 mg/mL | | form | Solid | | color | White to off-white | | InChIKey | LCPFHXWLJMNKNC-XOIICWPPNA-N | | SMILES | S(C1C=CC(C)=CC=1)(O)(=O)=O.C(C1=CC=CC2=CN(C3C=CC([C@H]4CNCCC4)=CC=3)N=C12)(=O)N |&1:23,r| |
| | Niraparib tosylate Usage And Synthesis |
| FDA Approved | Yes
| | Uses | Niraparib tosylate hydrate is a sulfonic acid organic compound that can be used as a pharmaceutical intermediate. | | Mechanism of action |
Niraparib tosylate is an orally active poly (ADP-ribose) polymerase (PARP) inhibitor. By blocking the enzymes responsible for DNA repair, niraparib induces cytotoxicity in cancer cells.
| | Synthesis | (S)-3-(4-aminophenyl)piperidine was obtained by chiral resolution, then condensed with methyl 3-formyl-2-nitrobenzoate to construct a pyrazole ring in the presence of sodium azide. Niraparib was subsequently synthesized under ammonia and acidic conditions. |
| | Niraparib tosylate Preparation Products And Raw materials |
|