|
|
| | 4-Methylsulphonylacetophenone Basic information |
| | 4-Methylsulphonylacetophenone Chemical Properties |
| Melting point | 126-129 °C(lit.) | | Boiling point | 305.56°C (rough estimate) | | density | 1.3339 (rough estimate) | | refractive index | 1.5250 (estimate) | | storage temp. | Sealed in dry,Room Temperature | | solubility | DMSO (Slightly), Methanol (Slightly, Heated) | | form | Crystalline Powder or Needles | | color | White to slightly yellow | | InChI | InChI=1S/C9H10O3S/c1-7(10)8-3-5-9(6-4-8)13(2,11)12/h3-6H,1-2H3 | | InChIKey | KAVZYDHKJNABPC-UHFFFAOYSA-N | | SMILES | C(=O)(C1=CC=C(S(C)(=O)=O)C=C1)C | | CAS DataBase Reference | 10297-73-1(CAS DataBase Reference) |
| Hazard Codes | Xi | | Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29144000 | | Storage Class | 13 - Non Combustible Solids |
| | 4-Methylsulphonylacetophenone Usage And Synthesis |
| Chemical Properties | white to slightly yellow cryst. powder or needles | | Uses | 4′-(Methylsulfonyl)acetophenone may be used in the synthesis of:
- 3-(4-Methylsulfonylphenyl)-4-phenyl-2(5H)-furanone with potent apoptosis-inducing ability.
- Bromo-4-methylsulfonylacetophenone, an intermediate for preparing DL-threo-2-dichloroacetamido-1-(4-methylsulfonylphenyl)-1,3-propanediol.
- 1-N-Substituted-3,5-diphenyl-2-pyrazoline derivatives, which show promising anti-inflammatory activity.
| | Uses | 4-(Methylsulfonyl)acetophenone is an impurity of Etoricoxib (E934100), which is a specific inhibitor of COX-2. |
| | 4-Methylsulphonylacetophenone Preparation Products And Raw materials |
|