| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:LeucoMalachite green-D6
Remarks:CS-W-00165
|
| Company Name: |
TianJin Alta Scientific Co., Ltd.
|
| Tel: |
022-65378550-8551 |
| Email: |
contact@altascientific.com |
| Products Intro: |
Product Name:LeucoMalachite green D6
CAS:1173021-13-0
Purity:98%
|
| Company Name: |
Alta Scientific Co., Ltd.
|
| Tel: |
022-6537-8550 15522853686 |
| Email: |
sales@altasci.com.cn |
| Products Intro: |
Product Name:Leucomalachite green-d6
CAS:1173021-13-0
Purity:99% Package:10mg;100mg;1g
|
| Company Name: |
Shanghai wechem chemical co., ltd
|
| Tel: |
18824865657 |
| Email: |
2684615189@qq.com |
| Products Intro: |
Product Name:Leuco Malachite Green-D6
CAS:1173021-13-0
Purity:99.9% Package:1mg;4mg
|
LEUCOMALACHITE GREEN D6 manufacturers
|
| | LEUCOMALACHITE GREEN D6 Basic information |
| Product Name: | LEUCOMALACHITE GREEN D6 | | Synonyms: | LeucoMalachite green-D6 (LMG-D6);LEUCOMALACHITE GREEN D6;4-[deuterio-[4-(dimethylamino)phenyl]-(2,3,4,5,6-pentadeuteriophenyl)methyl]-N,N-dimethylaniline;[2H6]-Leucomalachite Green;Leucomalachite Green-d6 (phenylmethylene-d6);Leucomalachite green-d6 Solution in Acetonitrile, 100μg/mL;Leucomalachite green D6 Solution in Methanol,1000μg/mL;Leucomalachite Green-d6 | | CAS: | 1173021-13-0 | | MF: | C23H20D6N2 | | MW: | 336.5 | | EINECS: | | | Product Categories: | | | Mol File: | Mol File |  |
| | LEUCOMALACHITE GREEN D6 Chemical Properties |
| Melting point | 103 - 105°C | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | color | White to Off-White | | Major Application | cleaning products
cosmetics
environmental
food and beverages
personal care | | InChI | 1S/C23H26N2/c1-24(2)21-14-10-19(11-15-21)23(18-8-6-5-7-9-18)20-12-16-22(17-13-20)25(3)4/h5-17,23H,1-4H3/i5D,6D,7D,8D,9D,23D | | InChIKey | WZKXBGJNNCGHIC-OOBYGUTHSA-N | | SMILES | [2H]c1c([2H])c([2H])c(c([2H])c1[2H])C([2H])(c2ccc(cc2)N(C)C)c3ccc(cc3)N(C)C |
| Hazard Codes | Xn,N | | Risk Statements | 22-50/53 | | Safety Statements | 60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral
Aquatic Acute 1
Aquatic Chronic 1
Carc. 2
Muta. 2 |
| | LEUCOMALACHITE GREEN D6 Usage And Synthesis |
| Uses | Leucomalachite Green-d6 is a labeled analog of leucomalachite green (LMG) (1173021-13-0), a major metabolite of malachite green (M110400). Dyes and metabolites, Environmental Testing. |
| | LEUCOMALACHITE GREEN D6 Preparation Products And Raw materials |
|