- FMOC-ACPC-OH
-
- $3.00
-
2019-07-06
- CAS:126705-22-4
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 100kg
|
| | FMOC-ACPC-OH Basic information |
| | FMOC-ACPC-OH Chemical Properties |
| Melting point | 225-226 | | Boiling point | 566.9±29.0 °C(Predicted) | | density | 1.39±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | powder | | pka | 3.97±0.20(Predicted) | | Appearance | White to off-white Solid | | BRN | 9348574 | | Major Application | peptide synthesis | | InChI | 1S/C19H17NO4/c21-17(22)19(9-10-19)20-18(23)24-11-16-14-7-3-1-5-12(14)13-6-2-4-8-15(13)16/h1-8,16H,9-11H2,(H,20,23)(H,21,22) | | InChIKey | OPPOISJKHBLNPD-UHFFFAOYSA-N | | SMILES | OC(=O)C1(CC1)NC(=O)OCC2c3ccccc3-c4ccccc24 |
| Hazard Codes | Xi | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2924297099 | | Storage Class | 13 - Non Combustible Solids |
| | FMOC-ACPC-OH Usage And Synthesis |
| Chemical Properties | White crystalline powder | | Uses | peptide synthesis | | reaction suitability | reaction type: Fmoc solid-phase peptide synthesis |
| | FMOC-ACPC-OH Preparation Products And Raw materials |
|