- 4,5-Diaminopyrimidine
-
- $1.10
-
2025-11-18
- CAS:13754-19-3
- Min. Order: 1g
- Purity: 99.00%
- Supply Ability: 100 Tons Min
|
| | 4,5-Diaminopyrimidine Basic information |
| | 4,5-Diaminopyrimidine Chemical Properties |
| Melting point | 204-206 °C(lit.) | | Boiling point | 229 °C32 mm Hg(lit.) | | density | 1.2105 (rough estimate) | | refractive index | 1.7380 (estimate) | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | pka | 6.06±0.10(Predicted) | | form | Liquid | | color | Clear colorless | | BRN | 112646 | | InChI | InChI=1S/C4H6N4/c5-3-1-7-2-8-4(3)6/h1-2H,5H2,(H2,6,7,8) | | InChIKey | PPAULTVPKLVLII-UHFFFAOYSA-N | | SMILES | C1=NC=C(N)C(N)=N1 | | CAS DataBase Reference | 13754-19-3(CAS DataBase Reference) | | NIST Chemistry Reference | 4,5-Pyrimidinediamine(13754-19-3) |
| WGK Germany | 3 | | F | 10 | | HS Code | 29335995 | | Storage Class | 11 - Combustible Solids |
| | 4,5-Diaminopyrimidine Usage And Synthesis |
| Chemical Properties | Brown crystals | | Uses | 4,5-Diaminopyrimidine is an intermediate in the synthesis of Nisin, a compound that was first introduced as a good preservative and was later on discovered to have antibacterial activity against gram positive bacteria. 4,5-Diaminopyrimidine is also used as a reagent to synthesize uracil-based 2-aminoanilide derivatives, compounds that act as histone deacetylase inhibitors. |
| | 4,5-Diaminopyrimidine Preparation Products And Raw materials |
|