|
|
| | 3-OXO-2,3-DIHYDROBENZO[B]THIOPHENE 1,1-DIOXIDE Basic information |
| Product Name: | 3-OXO-2,3-DIHYDROBENZO[B]THIOPHENE 1,1-DIOXIDE | | Synonyms: | 3-OXO-2,3-DIHYDROBENZO[B]THIOPHENE 1,1-DIOXIDE;benzo[b]thiophene-3(2H)-one 1,1-dioxide;3-Oxo-2,3-dihydro-1-benzothiophene 1,1-dioxide;1,1-diketobenzothiophen-3-one;1,1-dioxo-1-benzothiophen-3-one;Benzo[b]thiophen-3(2H);1,1-dioxobenzothiophen-3-one;1-benzothiophen-3(2H)-one 1,1-dioxide | | CAS: | 1127-35-1 | | MF: | C8H6O3S | | MW: | 182.2 | | EINECS: | 214-429-8 | | Product Categories: | | | Mol File: | 1127-35-1.mol | ![3-OXO-2,3-DIHYDROBENZO[B]THIOPHENE 1,1-DIOXIDE Structure](/CAS/GIF/1127-35-1.gif) |
| | 3-OXO-2,3-DIHYDROBENZO[B]THIOPHENE 1,1-DIOXIDE Chemical Properties |
| Melting point | 134-135 °C | | Boiling point | 424.6±38.0 °C(Predicted) | | density | 1.498±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | form | solid | | color | Yellow | | InChI | InChI=1S/C8H6O3S/c9-7-5-12(10,11)8-4-2-1-3-6(7)8/h1-4H,5H2 | | InChIKey | LXCYNALXWGQUIK-UHFFFAOYSA-N | | SMILES | O=S1(CC(C2=CC=CC=C21)=O)=O |
| | 3-OXO-2,3-DIHYDROBENZO[B]THIOPHENE 1,1-DIOXIDE Usage And Synthesis |
| | 3-OXO-2,3-DIHYDROBENZO[B]THIOPHENE 1,1-DIOXIDE Preparation Products And Raw materials |
|