- Pyrocatechol Violet
-
- $1.00
-
2019-07-06
- CAS:115-41-3
- Min. Order: 1G
- Purity: 99%
- Supply Ability: 100KG
|
| | Pyrocatechol Violet Basic information |
| Product Name: | Pyrocatechol Violet | | Synonyms: | Pyrocatechimsulfonphthalein violed;PYROCATECHOL VIOLET, FOR COLORIMETRY;PYROCATECHOL VIOLET INDICATOR FOR METAL TITRATION;PYROCATECHOL VIOLET, INDICATOR GRADE;PyrocatecholVioletGr;Pyrocatechol Violet, indicator grade, pure;1,2-Benzenediol, 4,4-(1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis-;Catecholsulfonphthalein | | CAS: | 115-41-3 | | MF: | C19H14O7S | | MW: | 386.38 | | EINECS: | 204-088-3 | | Product Categories: | bulk reagents | | Mol File: | 115-41-3.mol |  |
| | Pyrocatechol Violet Chemical Properties |
| Melting point | 185 °C (dec.)(lit.) | | Boiling point | 659.5±55.0 °C(Predicted) | | density | 1.632±0.06 g/cm3(Predicted) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | H2O: 1 mg/mL, clear, red | | pka | 7.21±0.10(Predicted) | | form | Metallic or Crystalline Powder | | color | Dark red-brown | | PH Range | 6.0(YELLOW)-7.0(PURPLE)-9.0(PURPLISH RED) | | Water Solubility | Soluble in water, ethylene glycol, monomethyl ether and ethanol. | | BRN | 353938 | | Stability: | Stable. Incompatible with strong oxidizing agents. | | Major Application | diagnostic assay manufacturing hematology histology | | InChI | 1S/C19H14O7S/c20-14-7-5-11(9-16(14)22)19(12-6-8-15(21)17(23)10-12)13-3-1-2-4-18(13)27(24,25)26/h1-10,20,22-23H,(H,24,25,26)/b19-12+ | | InChIKey | HGPSVOAVAYJEIJ-XDHOZWIPSA-N | | SMILES | Oc1ccc(cc1O)C(=C2\C=CC(=O)C(O)=C2)\c3ccccc3S(O)(=O)=O | | CAS DataBase Reference | 115-41-3(CAS DataBase Reference) | | EPA Substance Registry System | 1,2-Benzenediol, 4,4'-(1,1-dioxido-3H-2,1-benzoxathiol-3-ylidene)bis- (115-41-3) |
| Risk Statements | 36/37/38 | | Safety Statements | 24/25 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 32041900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 |
| | Pyrocatechol Violet Usage And Synthesis |
| Chemical Properties | greenish yellow powder | | Uses | A complexometric indicator. | | Uses | Pyrocatechol Violet is a complexometric indicator dye. This phthalein dye chelates metals to form blue to blue-violet complexs. It is also a pH indicator with a transition interval from 0 - 8 (red to violet). It is known to be unstable when alkaline. The stability is improved at a neutral pH. When the pH is between 2-7 the color may be yellow. Dyes and metabolites. | | Purification Methods | It is recrystallised from glacial acetic acid. It is very hygroscopic and is an indicator standard for metal complex titrations. [Mustafin et al. Zh Anal Khim 22 1808 1967, Beilstein 19/3 V 703.] |
| | Pyrocatechol Violet Preparation Products And Raw materials |
|