|
|
| | N,N-Dimethylphenethylamine Basic information |
| Product Name: | N,N-Dimethylphenethylamine | | Synonyms: | Benzeneethanamine, dimethyl-;Dimethylaminoethylbenzene;N,N-Dimethyl-2-phenethylamine;N,N-Dimethylbenzeneethanamine;N,N-Dimethyl-beta-phenethylamine;Phenethylamine, N,N-dimethyl-;Phenylethylamine, N,N-dimethyl;N,N-DiMethyl-2-phenylethanaMine HCl | | CAS: | 1126-71-2 | | MF: | C10H15N | | MW: | 149.23 | | EINECS: | 244-942-2 | | Product Categories: | Amines;C9 to C10;Nitrogen Compounds | | Mol File: | 1126-71-2.mol |  |
| | N,N-Dimethylphenethylamine Chemical Properties |
| Melting point | 143°C (estimate) | | Boiling point | 207-212 °C (lit.) | | density | 0.89 g/mL at 25 °C (lit.) | | refractive index | n20/D 1.502(lit.) | | Fp | 160 °F | | storage temp. | Hygroscopic, Refrigerator, under inert atmosphere | | solubility | Chloroform (Slightly), Methanol (Slightly) | | form | Oil | | pka | 9.75±0.28(Predicted) | | color | Colourless | | JECFA Number | 1613 | | InChI | InChI=1S/C10H15N/c1-11(2)9-8-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3 | | InChIKey | TXOFSCODFRHERQ-UHFFFAOYSA-N | | SMILES | C1(CCN(C)C)=CC=CC=C1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | N,N-Dimethylphenethylamine Usage And Synthesis |
| Chemical Properties | The boiling point of this product is 205℃, 66-68℃ (0.8kPa). | | Uses | N,N-Dimethyl-2-phenylethanamine is used in the study of photolytic decomposition products of UV-photoinitiators in food packaging. N,N-Dimethyl-2-phenylethanamine is also a useful reagent in organic synthesis. | | Definition | ChEBI: N,N-Dimethylphenethylamine is a primary amine. | | Preparation | N,N-Dimethyl-2-phenylethylamine is synthesized by the reaction of phenethylamine with formaldehyde and formic acid. | | Synthesis Reference(s) | Organic Syntheses, Coll. Vol. 3, p. 723, 1955 Tetrahedron Letters, 21, p. 4061, 1980 DOI: 10.1016/0040-4039(80)88066-X |
| | N,N-Dimethylphenethylamine Preparation Products And Raw materials |
|