- CLOPROSTENOL
-
- $21.00
-
2025-06-25
- CAS:40665-92-7
- Min. Order: 1KG
- Purity: 99.0% min
- Supply Ability: 100 tons
- CLOPROSTENOL
-
- $1.00
-
2019-07-06
- CAS:40665-92-7
- Min. Order: 1kg
- Purity: 95%-99%
- Supply Ability: 100kg
|
| | CLOPROSTENOL Basic information |
| Product Name: | CLOPROSTENOL | | Synonyms: | (1-alpha-(z),2-beta-(1e,3r*),3-alpha,5-alpha)-(+-)-yclopentyl);(+)-16-M-CHLOROPHENOXY TETRANOR PROSTAGLANDIN F2ALPHA;(+)-9ALPHA,11ALPHA,15-TRIHYDROXY-16-(3-CHLOROPHENOXY)-17,18,19,20-TETRANOR-PROSTA-5Z,13E-DIEN-1-OIC ACID;CLOPROSTENOL;5-heptenoicacid,7-(2-(4-(3-chlorophenoxy)-3-hydroxy-1-butenyl)-3,5-dihydroxyc;estrumate;i.c.i.ltd.compoundnumber80996;ici80996 | | CAS: | 40665-92-7 | | MF: | C22H29ClO6 | | MW: | 424.92 | | EINECS: | 255-028-8 | | Product Categories: | Prostaglandins | | Mol File: | 40665-92-7.mol |  |
| | CLOPROSTENOL Chemical Properties |
| Boiling point | 535.77°C (rough estimate) | | density | 1.1217 (rough estimate) | | refractive index | 1.4429 (estimate) | | storage temp. | -20°C Freezer, Under Inert Atmosphere | | solubility | Chloroform (Slightly), DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 4.76±0.10(Predicted) | | color | Colourless to Yellow | | InChIKey | VJGGHXVGBSZVMZ-QAAGTRDINA-N | | SMILES | C(O)(=O)CCC/C=C\C[C@H]1[C@@H](O)C[C@@H](O)[C@@H]1/C=C/[C@@H](O)COC1=CC=CC(Cl)=C1 |&1:9,10,13,15,18,r| | | CAS DataBase Reference | 40665-92-7(CAS DataBase Reference) |
| | CLOPROSTENOL Usage And Synthesis |
| Uses | Aryl-oxymethyl analog of prostaglandin F2α. | | Uses | Prostaglandin. | | Definition | ChEBI: Cloprostenol is a prostanoid. | | Brand name | Estrumate(Bayer Animal
Health). | | Safety Profile | Experimental
reproductive effects. When heated to
decomposition it emits toxic fumes of Cl-. |
| | CLOPROSTENOL Preparation Products And Raw materials |
|