[4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride manufacturers
- (4, 4 dtbbpy) NiCl2
-
-
2026-05-19
- CAS:1034901-50-2
- Min. Order: 1g
- Purity: 99.90%
- Supply Ability: 100kgs
|
| | [4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride Basic information |
| Product Name: | [4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride | | Synonyms: | [4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride;(4, 4 dtbbpy) NiCl2;[4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichl;4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride;4,4'-di-tert-butyl-2,2'-bipyridine Nickel(II) dichloride;(4,4'-dtbbpy)NiCl2 / [4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride;Nickel, [4,4′-bis(1,1-dimethylethyl)-2,2′-bipyridine-κN1,κN1′]dichloro-, (SP-4-2…;(4,4'-dtbbpy)NiCl2 | | CAS: | 1034901-50-2 | | MF: | C18H24Cl2N2Ni | | MW: | 398 | | EINECS: | | | Product Categories: | | | Mol File: | 1034901-50-2.mol | ![[4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride Structure](CAS/20200331/GIF/1034901-50-2.gif) |
| | [4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride Chemical Properties |
| Melting point | >300 °C | | storage temp. | under inert gas (nitrogen or Argon) at 2-8°C | | form | powder or crystals | | InChIKey | PCWIKFRTCXESOT-UHFFFAOYSA-L | | SMILES | CC(C1=CC(C2=CC(C(C)(C)C)=CC=N2)=NC=C1)(C)C.Cl[Ni]Cl |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | [4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride Usage And Synthesis |
| Uses | [4,4′-Bis(1,1-dimethylethyl)-2,2′-bipyridine] nickel (II) dichloride can be used as a catalyst in:
- Decarboxylative arylation of oxo acids.
- Acylation of ethers.
- Cross-coupling of aryl bromides with alcohols.
| | reaction suitability | core: nickel reaction type: Cross Couplings reagent type: catalyst |
| | [4,4'-Bis(1,1-dimethylethyl)-2,2'-bipyridine] nickel (II) dichloride Preparation Products And Raw materials |
|