|
|
| | 1-BROMO-2,4,6-TRI-TERT-BUTYLBENZENE Basic information |
| Product Name: | 1-BROMO-2,4,6-TRI-TERT-BUTYLBENZENE | | Synonyms: | 1-BROMO-2,4,6-TRI-TERT-BUTYLBENZENE 97+%;Bromo(1,3,5-tris-tert-butyl)benzene;NSC 133894;2,4,6-Tri-tert-butylphenyl bromide;1-BroMo-2,4,6-tri-tert-butylbenzene 97%;Bromobenzene, 2,4,6-tri-tert-butyl-;1-BROMO-2,4,6-TRI-TERT-BUTYLBENZENE;Benzene, 2-bromo-1,3,5-tris(1,1-dimethylethyl)- | | CAS: | 3975-77-7 | | MF: | C18H29Br | | MW: | 325.33 | | EINECS: | | | Product Categories: | Aryl;C13 to C37+;Halogenated Hydrocarbons | | Mol File: | 3975-77-7.mol |  |
| | 1-BROMO-2,4,6-TRI-TERT-BUTYLBENZENE Chemical Properties |
| Melting point | 168-173 °C (lit.) | | Boiling point | 299.7±9.0 °C(Predicted) | | density | 1.064±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | Appearance | White to off-white Solid | | BRN | 1913257 | | InChI | InChI=1S/C18H29Br/c1-16(2,3)12-10-13(17(4,5)6)15(19)14(11-12)18(7,8)9/h10-11H,1-9H3 | | InChIKey | JOKZWHPYNRDCOA-UHFFFAOYSA-N | | SMILES | C1(C(C)(C)C)=CC(C(C)(C)C)=CC(C(C)(C)C)=C1Br |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 1-BROMO-2,4,6-TRI-TERT-BUTYLBENZENE Usage And Synthesis |
| Uses | 1-Bromo-2,4,6-tri-tert-butylbenzene was used in the synthesis of bulky biarylphosphine ligand. This ligand was reported to participate in the Pd-catalyzed C-O cross-coupling of a wide range of aryl halides and phenols under milder conditions. It was used to investigate the effect on oligomerization of increased steric bulk in dimethylindium(III) chalcogenolates. It may be used to form α,α-dimethyl-β-phenyl hydrostyrene by reacting with phenylboronic acid. | | General Description | 1-Bromo-2,4,6-tri-tert-butylbenzene (2,4,6-tri-tert-butylbromobenzene) is a hindered aryl bromide. 1-Bromo-2,4,6-tri-tert-butylbenzene on reaction with phenylboronic acid yields α,α-dimethyl-β-phenyl hydrostyrene. |
| | 1-BROMO-2,4,6-TRI-TERT-BUTYLBENZENE Preparation Products And Raw materials |
|