|
|
| | TETRATHIAFULVALENE 7 7 8 8-TETRACYANO- Basic information |
| Product Name: | TETRATHIAFULVALENE 7 7 8 8-TETRACYANO- | | Synonyms: | TETRATHIAFULVALENE 7 7 8 8-TETRACYANO-;7,7,8,8-Tetracyanoquinodimethane Tetrathiafulvalene salt, TCNQ-TTF, TTF-TCNQ;Tetrathiafulvalene7,7,8,8-TetracyanoquinodimethaneSalzanlqjknldketnae;Tetrathiafulvalene - 7,7,8,8-Tetracyanoquinodimethane Complex;TTF - TCNQ Complex;Tetrathiafulvalene-7,7,8,8-Tetracyanoquinodimethane;2,2'-cyclohexa-2,5-diene-1,4-diylidenedipropanedinitrile - 2,2'-bi-1,3-dithiole (1:1);2,2'-(cyclohexa-2,5-diene-1,4-diylidene)dimalononitrile compound with 2,2'-bi(1,3-dithiolylidene) (1:1) | | CAS: | 40210-84-2 | | MF: | C18H8N4S4 | | MW: | 408.53 | | EINECS: | | | Product Categories: | Acceptors (Charge Transfer Complexes);Charge Transfer Complexes for Organic Metals;Donors (Charge Transfer Complexes);Functional Materials;TCNQ Derivatives;TTF Derivatives | | Mol File: | 40210-84-2.mol |  |
| | TETRATHIAFULVALENE 7 7 8 8-TETRACYANO- Chemical Properties |
| Melting point | ~-230 °C (dec.) | | storage temp. | -20°C Freezer, Under inert atmosphere | | solubility | Pyridine (Slightly, Heated), Toluene (Slightly, Heated) | | form | Solid | | color | Dark Blue to Black | | InChI | 1S/C12H4N4.C6H4S4/c13-5-11(6-14)9-1-2-10(4-3-9)12(7-15)8-16;1-2-8-5(7-1)6-9-3-4-10-6/h1-4H;1-4H | | InChIKey | OIXMVDHMELKBDX-UHFFFAOYSA-N | | SMILES | S1C=CS\C1=C2/SC=CS2.N#C\C(C#N)=C3\C=CC(\C=C3)=C(\C#N)C#N |
| Safety Statements | 22-24/25 | | RIDADR | UN 3439 6.1/PG III | | WGK Germany | 3 | | F | 9 | | HS Code | 2942.00.3500 | | HazardClass | 6.1 | | PackingGroup | III | | Storage Class | 11 - Combustible Solids |
| | TETRATHIAFULVALENE 7 7 8 8-TETRACYANO- Usage And Synthesis |
| Uses | TTF-TCNQ has been used in sensor fabrication during amperometric lactate biosensor development for qualitative analysis of lactate accumulation in ischemic myocardium patients. | | General Description | Visit our Sensor Applications portal to learn more. |
| | TETRATHIAFULVALENE 7 7 8 8-TETRACYANO- Preparation Products And Raw materials |
|