|
|
| | (S)-N-BOC-TERT-LEUCINOL 98 Basic information |
| | (S)-N-BOC-TERT-LEUCINOL 98 Chemical Properties |
| Melting point | 102-103 °C | | Boiling point | 313.7±25.0 °C(Predicted) | | density | 0.986±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 12.11±0.46(Predicted) | | form | Crystalline Powder | | color | White | | Major Application | peptide synthesis | | InChI | InChI=1S/C11H23NO3/c1-10(2,3)8(7-13)12-9(14)15-11(4,5)6/h8,13H,7H2,1-6H3,(H,12,14)/t8-/m1/s1 | | InChIKey | AZHJHZWFJVBGIL-MRVPVSSYSA-N | | SMILES | C(OC(C)(C)C)(=O)N[C@H](CO)C(C)(C)C |
| WGK Germany | 3 | | HS Code | 29225000 | | Storage Class | 11 - Combustible Solids |
| | (S)-N-BOC-TERT-LEUCINOL 98 Usage And Synthesis |
| Uses | N-Boc-(S)-(+)-tert-leucinol (cas# 153645-26-2) is a compound useful in organic synthesis. | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | (S)-N-BOC-TERT-LEUCINOL 98 Preparation Products And Raw materials |
|