- Boc-N-Me-D-Ala-OH
-
-
2026-06-05
- CAS:19914-38-6
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
|
| | BOC-N-methyl-D-alanine Basic information |
| | BOC-N-methyl-D-alanine Chemical Properties |
| Melting point | 88-92°C | | alpha | 30 º (c=1,EtOH) | | Boiling point | 296.3±19.0 °C(Predicted) | | density | 1.111±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | soluble in Ethanol | | form | Crystalline Powder | | pka | 4.03±0.10(Predicted) | | color | White | | Optical Rotation | 26.1°(C=0.01g/mL,ETOH, 20°C, 589nm) | | BRN | 3606540 | | Major Application | peptide synthesis | | InChI | 1S/C9H17NO4/c1-6(7(11)12)10(5)8(13)14-9(2,3)4/h6H,1-5H3,(H,11,12)/t6-/m1/s1 | | InChIKey | VLHQXRIIQSTJCQ-ZCFIWIBFSA-N | | SMILES | C[C@@H](N(C)C(=O)OC(C)(C)C)C(O)=O | | CAS DataBase Reference | 19914-38-6(CAS DataBase Reference) |
| Safety Statements | 24/25 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 29241990 | | Storage Class | 13 - Non Combustible Solids |
| | BOC-N-methyl-D-alanine Usage And Synthesis |
| Chemical Properties | White solid | | Uses | peptide synthesis | | reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| | BOC-N-methyl-D-alanine Preparation Products And Raw materials |
|