| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:Guanidine-13C,15N3 hydrochloride CAS:285977-73-3 Purity:99 atom % 13C, 98 atom % 15N Package:100MG Remarks:607312-100MG
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:Guanidine-13C,15N3 Hydrochloride CAS:285977-73-3 Purity:NULL Package:10mg;1mg;100mg Remarks:NULL
|
| Company Name: |
Shanghai Aladdin Biochemical Technology Co.,Ltd.
|
| Tel: |
6206333 13167063860 |
| Email: |
anhua.mao@aladdin-e.com |
| Products Intro: |
Product Name:Guanidine-13C,1?N? hydrochloride CAS:285977-73-3 Purity:≥98 atom% 15N,≥99 atom% 13C Package:100mg/RMB 11519.90
|
GUANIDINE-13C, 15N HCL manufacturers
|
| | GUANIDINE-13C, 15N HCL Basic information |
| | GUANIDINE-13C, 15N HCL Chemical Properties |
| Melting point | 185-189 °C (lit.) | | form | solid | | InChI | 1S/CH5N3.ClH/c2-1(3)4;/h(H5,2,3,4);1H/i1+1,2+1,3+1,4+1; | | InChIKey | PJJJBBJSCAKJQF-UJNKEPEOSA-N | | SMILES | Cl[H].[15NH2][13C]([15NH2])=[15NH] |
| Hazard Codes | Xn | | Risk Statements | 22-41 | | Safety Statements | 26-36/37/39 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Eye Dam. 1 |
| | GUANIDINE-13C, 15N HCL Usage And Synthesis |
| Uses | Guanidine-13C,15N3 Hydrochloride is the isotope labelled analog of Guanidine Hydrochloride (G821245). Guanidine (G821245) has a good bacterial and fungicidal efficacy when used in low concentration and can also be used as disinfectant. |
| | GUANIDINE-13C, 15N HCL Preparation Products And Raw materials |
|