- Boc-Gly-Pro-OH
-
-
2026-06-05
- CAS:14296-92-5
- Min. Order: 1kg
- Purity: 98%
- Supply Ability: 1T+
- BOC-GLY-PRO-OH
-
- $1.00
-
2019-12-20
- CAS:14296-92-5
- Min. Order: 1g
- Purity: 99%
|
| | BOC-GLY-PRO-OH Basic information |
| Product Name: | BOC-GLY-PRO-OH | | Synonyms: | Boc-Gly-L-Pro-OH;Boc-Gly-Pro-OH≥ 99% (HPLC);NSC 341354;N-(tert-butoxycarbonyl)-Gly-Pro;(S)-1-(2-(tert-butoxycarbonylamino)acetyl)pyrrolidine-2-carboxylic acid;REF DUPL: Boc-Gly-Pro-OH;L-1-(N-Carboxyglycyl)proline N-tert-butyl ester;N-[(tert-butoxy)carbonyl]glycyl-L-proline | | CAS: | 14296-92-5 | | MF: | C12H20N2O5 | | MW: | 272.3 | | EINECS: | | | Product Categories: | Amino Acid Derivatives | | Mol File: | 14296-92-5.mol |  |
| | BOC-GLY-PRO-OH Chemical Properties |
| Melting point | 142-144℃ | | Boiling point | 490.9±40.0 °C(Predicted) | | density | 1.248 | | storage temp. | Sealed in dry,2-8°C | | pka | 3.51±0.20(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C12H20N2O5/c1-12(2,3)19-11(18)13-7-9(15)14-6-4-5-8(14)10(16)17/h8H,4-7H2,1-3H3,(H,13,18)(H,16,17)/t8-/m0/s1 | | InChIKey | CMSBRKBRYYDCFQ-QMMMGPOBSA-N | | SMILES | C(O)(=O)[C@@H]1CCCN1C(=O)CNC(OC(C)(C)C)=O |
| | BOC-GLY-PRO-OH Usage And Synthesis |
| Chemical Properties | White to off-white powder | | Uses | Boc-Gly-Pro-OH is a Glycine (HY-Y0966) derivative[1]. | | References | [1] Luckose F, et al. Effects of amino acid derivatives on physical, mental, and physiological activities. Crit Rev Food Sci Nutr. 2015;55(13):1793-1144. DOI:10.1080/10408398.2012.708368 |
| | BOC-GLY-PRO-OH Preparation Products And Raw materials |
|