| Company Name: |
Hangzhou WDJBIO Co., Ltd. Gold
|
| Tel: |
0571-86706360 18158111080 |
| Email: |
3168409019@qq.com |
| Products Intro: |
Product Name:(S)-1-CYCLOPROPYLETHANOL CAS:55637-37-1 Purity:99%GC Package:10G;100G;1KG;100KG
|
| Company Name: |
Aikon International Limited
|
| Tel: |
025-58859352 15955137747 |
| Email: |
sales01@aikonchem.com |
| Products Intro: |
Product Name:(S)-1-Cyclopropylethan-1-ol CAS:55637-37-1 Purity:95+% Package:1g;5g;10g
|
| Company Name: |
Bejing Famous Pharmaceutical Technology Co., Ltd.
|
| Tel: |
010-80339217; 13331045123 |
| Email: |
2559355526@qq.com |
| Products Intro: |
Product Name:(S)-1-CYCLOPROPYLETHANOL CAS:55637-37-1 Purity:95% Package:1g;5g;10g;25g;50g;100g;250g;500g;1Kg;5Kg;10Kg;25Kg;50Kg;100Kg;250Kg;500Kg
|
|
| | (S)-1-CYCLOPROPYLETHANOL Basic information |
| | (S)-1-CYCLOPROPYLETHANOL Chemical Properties |
| Boiling point | 123.5±0.0 °C(Predicted) | | density | 0.997±0.06 g/cm3(Predicted) | | storage temp. | Store at room temperature | | pka | 15.17±0.20(Predicted) | | Appearance | Colorless to light yellow Liquid | | Optical Rotation | 13.3575°(C=1g/100mL, CHCL3, 20°C, 589nm) | | InChI | InChI=1/C5H10O/c1-4(6)5-2-3-5/h4-6H,2-3H2,1H3/t4-/s3 | | InChIKey | DKKVKJZXOBFLRY-UFLUHPNLNA-N | | SMILES | C1([C@H](C)O)CC1 |&1:1,r| |
| | (S)-1-CYCLOPROPYLETHANOL Usage And Synthesis |
| | (S)-1-CYCLOPROPYLETHANOL Preparation Products And Raw materials |
|