|
|
| | Tris(4-isocyanatophenyl) thiophosphate Basic information |
| Product Name: | Tris(4-isocyanatophenyl) thiophosphate | | Synonyms: | 4-ISOCYANATOPHENOL PHOSPHOROTHIOATE (ESTER));4-isocyanatophenol phosphorothioate (3:1);Thiophosphoric-Tris-p-Isocyanato-Phenyl Ester;Phosphorothioic acid O,O,O-tri(4-isocyanatophenyl) ester;Thiophosphoric acid O,O,O-tri(4-isocyanatophenyl) ester;Thiophosphoric acid O,O,O-tris(4-isocyanatophenyl) ester;Thiophosphoric acid tris(4-isocyanatophenyl) ester;Thiophosphoric acid tris(p-isocyanatophenyl) ester | | CAS: | 4151-51-3 | | MF: | C21H12N3O6PS | | MW: | 465.38 | | EINECS: | 223-981-9 | | Product Categories: | | | Mol File: | 4151-51-3.mol |  |
| | Tris(4-isocyanatophenyl) thiophosphate Chemical Properties |
| Melting point | 84-86 °C | | Boiling point | 561.9±60.0 °C(Predicted) | | density | 1.37±0.1 g/cm3(Predicted) | | vapor pressure | 0Pa at 20℃ | | Fp | -4°C (25°F) | | Specific Gravity | 1.0 | | Water Solubility | 150μg/L at 20℃ | | Hydrolytic Sensitivity | 4: no reaction with water under neutral conditions | | InChI | InChI=1S/C21H12N3O6PS/c25-13-22-16-1-7-19(8-2-16)28-31(32,29-20-9-3-17(4-10-20)23-14-26)30-21-11-5-18(6-12-21)24-15-27/h1-12H | | InChIKey | KGLSETWPYVUTQX-UHFFFAOYSA-N | | SMILES | P(=S)(OC1C=CC(N=C=O)=CC=1)(OC1=CC=C(N=C=O)C=C1)OC1=CC=C(N=C=O)C=C1 | | LogP | 8.266 at 20℃ | | CAS DataBase Reference | 4151-51-3(CAS DataBase Reference) | | EPA Substance Registry System | Phenol, 4-isocyanato-, phosphorothioate (3:1) (ester) (4151-51-3) |
| RIDADR | 2206 | | TSCA | TSCA listed | | HazardClass | 6.1(b) | | PackingGroup | III |
| | Tris(4-isocyanatophenyl) thiophosphate Usage And Synthesis |
| Flammability and Explosibility | Non flammable |
| | Tris(4-isocyanatophenyl) thiophosphate Preparation Products And Raw materials |
|