|
|
| | 4-Bromo-2-fluorophenylacetic acid Basic information |
| Product Name: | 4-Bromo-2-fluorophenylacetic acid | | Synonyms: | 4-Bromo-2-fluorophenylacetic acid;Benzeneacetic acid, 4-bromo-2-fluoro-;4-Bromo-2-fluorophenylaceticacid,98%;4-Bromo-2-fluorophenylacetic acid ISO 9001：2015 REACH;4-Bromo-2-fluorobenzeneacetic acid | | CAS: | 114897-92-6 | | MF: | C8H6BrFO2 | | MW: | 233.03 | | EINECS: | | | Product Categories: | | | Mol File: | 114897-92-6.mol |  |
| | 4-Bromo-2-fluorophenylacetic acid Chemical Properties |
| Melting point | 123-126° | | Boiling point | 320.4±27.0 °C(Predicted) | | density | 1.697±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | pka | 3.89±0.10(Predicted) | | form | Solid | | Appearance | White to off-white Solid | | InChI | InChI=1S/C8H6BrFO2/c9-6-2-1-5(3-8(11)12)7(10)4-6/h1-2,4H,3H2,(H,11,12) | | InChIKey | PNBIYFPZODYMOO-UHFFFAOYSA-N | | SMILES | C1(CC(O)=O)=CC=C(Br)C=C1F |
| Hazard Codes | Xi | | HS Code | 2916399090 |
| | 4-Bromo-2-fluorophenylacetic acid Usage And Synthesis |
| Uses | 4-Bromo-2-fluorophenylacetic acid is a carboxylic acid organic compound, which can be used as a pharmaceutical intermediate for pharmaceutical synthesis and scientific research. | | Synthesis | 4-Bromo-2-fluorophenylacetic acid can be prepared by reacting 2-(4-bromo-2-fluorophenyl)acetonitrile with MeOH in NaOH solution. | | References | [1] Patent: US5827863, 1998, A
[2] Patent: US2014/275111, 2014, A1. Location in patent: Paragraph 0232; 0235; 0236
[3] Patent: WO2014/141187, 2014, A1. Location in patent: Page/Page column 44; 54; 57
[4] Patent: WO2011/45703, 2011, A2. Location in patent: Page/Page column 44-45
[5] Patent: WO2016/38519, 2016, A1. Location in patent: Page/Page column 36 |
| | 4-Bromo-2-fluorophenylacetic acid Preparation Products And Raw materials |
|