|
|
| | 7-Chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic acid Basic information |
| | 7-Chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic acid Chemical Properties |
| Melting point | 242-245 °C(lit.) | | Boiling point | 467.3±45.0 °C(Predicted) | | density | 1.652±0.06 g/cm3(Predicted) | | storage temp. | Sealed in dry,Room Temperature | | solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) | | pka | 6.36±0.41(Predicted) | | form | Solid | | color | Off-White to Light Yellow | | InChI | InChI=1S/C13H9ClFNO3/c14-9-4-11-7(3-10(9)15)12(17)8(13(18)19)5-16(11)6-1-2-6/h3-6H,1-2H2,(H,18,19) | | InChIKey | ISPVACVJFUIDPD-UHFFFAOYSA-N | | SMILES | N1(C2CC2)C2=C(C=C(F)C(Cl)=C2)C(=O)C(C(O)=O)=C1 | | CAS DataBase Reference | 86393-33-1(CAS DataBase Reference) |
| Hazard Codes | Xn,Xi | | Risk Statements | 22-36/37/38-52/53 | | Safety Statements | 26-36-61-22 | | WGK Germany | 2 | | RTECS | VB1993795 | | HazardClass | IRRITANT | | HS Code | 29334900 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 3 |
| | 7-Chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic acid Usage And Synthesis |
| Chemical Properties | Off-White Crystalline Powder | | Uses | 7-Chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxo-quinoline-3-carboxylic Acid (Ciprofloxacin EP Impurity A) is a metabolite of Ciprofloxacin, a fluorinated quinolone antibacterial. | | Uses | An intermediate in the synthesis of Ciprofloxacin, a fluorinated quinolone antibacterial | | General Description | 7-Chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic acid, also known as fluoroquinolonic acid, can be prepared from ethyl 2,4-dichloro-5-fluorobenzoylacetate. It is formed as an intermediate during the synthesis of ciprofloxacin hydrochloride, a fluorinated quinolone antibacterial drug. |
| | 7-Chloro-1-cyclopropyl-6-fluoro-1,4-dihydro-4-oxoquinoline-3-carboxylic acid Preparation Products And Raw materials |
|