|
|
| | 4'-Aminobiphenyl-4-carbonitrile Basic information |
| | 4'-Aminobiphenyl-4-carbonitrile Chemical Properties |
| Melting point | 182-186 °C(lit.) | | Boiling point | 320.68°C (rough estimate) | | density | 1.1579 (rough estimate) | | refractive index | 1.5014 (estimate) | | storage temp. | 2-8°C, protect from light | | Water Solubility | Insoluble in water | | solubility | Chloroform, Methanol (Sparingly) | | form | powder to crystal | | pka | 3.78±0.10(Predicted) | | color | White to Amber | | InChI | 1S/C13H10N2/c14-9-10-1-3-11(4-2-10)12-5-7-13(15)8-6-12/h1-8H,15H2 | | InChIKey | CPJQKNUJNWPAPH-UHFFFAOYSA-N | | SMILES | Nc1ccc(cc1)-c2ccc(cc2)C#N | | CAS DataBase Reference | 4854-84-6(CAS DataBase Reference) |
| Hazard Codes | Xn,N | | Risk Statements | 20/21/22-41-50 | | Safety Statements | 26-36/39-60-61 | | RIDADR | UN 3077 9/PG 3 | | WGK Germany | 2 | | RTECS | DV1763000 | | HS Code | 2926907090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal Acute Tox. 4 Inhalation Acute Tox. 4 Oral Aquatic Acute 1 Eye Dam. 1 |
| | 4'-Aminobiphenyl-4-carbonitrile Usage And Synthesis |
| Uses | 4-(4-Aminophenyl)benzonitrile is used as a reagent in the synthesis of pirinixic acid derivatives which serve as dual microsomal PGE2 synthase-1/5-lipoxygenase inhibitors. Also used as a reagent in the synthesis of novel diazepane derivatives as factor Xa inhibitors with potent anticoagulant and antithrombotic activity. |
| | 4'-Aminobiphenyl-4-carbonitrile Preparation Products And Raw materials |
|