|
|
| | 5-Sulfosalicylic acid dihydrate Basic information |
| Product Name: | 5-Sulfosalicylic acid dihydrate | | Synonyms: | Benzoicacid,2-hydroxy-5-sulfo-,dihydrate;Salicylic acid, 5-sulfo-, dihydrate;5-Sulfosalicylic acid dihydrate, ACS, 99.0% min.;5-SULFOSALICYLIC ACID DIHYDRATE*ELEC;5-SULFOSALICYLIC ACID DIHYDRATE*ACS REAGENT;5-SULFOSALICYLIC ACID DIHYDRATE, REAGENTPLUS TM, >= 99%;5-SULFOSALICYLIC ACID DIHYDRATE, FOR ELE CTROPHORESIS;5-SULFOSALICYLIC ACID-2-HYDRATE R. G. AN D FOR METAL TITRATION, REAG. ACS | | CAS: | 5965-83-3 | | MF: | C7H10O8S | | MW: | 254.21 | | EINECS: | 641-618-6 | | Product Categories: | Rubber Chemicals;Organic acids;5965-83-3 | | Mol File: | 5965-83-3.mol |  |
| | 5-Sulfosalicylic acid dihydrate Chemical Properties |
| Melting point | 105-110 °C(lit.) | | Boiling point | 100 °C | | density | 0,8 g/cm3 | | bulk density | 310kg/m3 | | vapor density | 0.62 (vs air) | | vapor pressure | <1 hPa (20 °C) | | Fp | 150°C | | storage temp. | Store below +30°C. | | solubility | H2O: 1 M at 20 °C, clear, colorless | | form | Powder | | color | White | | Odor | Odorless | | PH | <0.5 (200g/l, H2O, 20℃) | | Water Solubility | SOLUBLE | | Sensitive | Light Sensitive | | Merck | 14,8964 | | BRN | 650741 | | Stability: | Stable, but light sensitive. Incompatible with strong oxidizing agents. | | InChI | 1S/C7H6O6S.2H2O/c8-6-2-1-4(14(11,12)13)3-5(6)7(9)10;;/h1-3,8H,(H,9,10)(H,11,12,13);2*1H2 | | InChIKey | BHDKTFQBRFWJKR-UHFFFAOYSA-N | | SMILES | [H]O[H].[H]O[H].OC(=O)c1cc(ccc1O)S(O)(=O)=O | | CAS DataBase Reference | 5965-83-3(CAS DataBase Reference) | | NIST Chemistry Reference | Benzoic acid, 2-hydroxy-5-sulfo-, dihydrate(5965-83-3) | | EPA Substance Registry System | Benzoic acid, 2-hydroxy-5-sulfo-, dihydrate (5965-83-3) |
| Hazard Codes | Xn,C,Xi | | Risk Statements | 22-36/37/38-34 | | Safety Statements | 26-45-36/37/39-36 | | RIDADR | UN 3261 8 / PGII | | WGK Germany | 3 | | RTECS | VO6500000 | | F | 8 | | TSCA | Yes | | HS Code | 2918 29 00 | | HazardClass | 8 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B | | Toxicity | LD50 orally in Rabbit: 1850 mg/kg |
| | 5-Sulfosalicylic acid dihydrate Usage And Synthesis |
| Chemical Properties | white crystalline powder | | Uses | 5-Sulfosalicylic acid dihydrate may be used in the preparation of 1:1 proton-transfer organic adduct, 3-aminopyridin-ium 3-carb-oxy-4-hydroxy-benzene-sulfonate monohydrate and the anhydrous adduct. | | Uses | 5-Sulfosalicylic Acid Dihydrate is for reducing and fixation of proteins in agarose and polyacrylamide gels. | | General Description | 5-Sulfosalicylic acid is a strong acid capable of protonating water. It forms a new theophylline complex, which was investigated by X-ray photoelectron spectroscopy (XPS). It forms 1:1 proton-transfer compounds with the ortho-substituted monocyclic heteroaromatic Lewis bases. Their crystal structures have been studied. | | Synthesis | Nitration reaction: Salicylic acid is mixed with concentrated sulfuric acid and concentrated nitric acid, and the nitration reaction is carried out at low temperature to obtain nitrosalicylic acid. The reaction needs to be matched with conditions such as ice bath and slowly adding nitric acid to control the temperature and reaction rate. Reducing denitrification: Nitrosalicylic acid is added to concentrated sulfuric acid and the nitro group is removed at high temperature to form 5-sulfosalicylic acid. A reducing agent (e.g., sodium sulfite) can be used in this step to facilitate the reaction. Crystallization and purification: the desired 5-sulfosalicylic acid is extracted and purified from the reaction product by methods such as crystallization techniques or column chromatography. | | Purification Methods | Crystallise the acid from H2O. Alternatively, it is converted to the monosodium salt which is crystallised from H2O and washed with a little H2O, EtOH and then Et2O. The acid is recovered by acidifying. The S-4-chlorobenzylisothiuronium salt has m 181o (from dioxane). [Beilstein 11 H 411, 11 II 232, 11 III 704.] |
| | 5-Sulfosalicylic acid dihydrate Preparation Products And Raw materials |
|