|
|
| | L-Amoxicillin Basic information |
| Product Name: | L-Amoxicillin | | Synonyms: | (2S,5R,6R)-6-((S)-2-Amino-2-(4-hydroxyphenyl)acetamido)-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo;(2S,5R,6R)-6-[[(2S)-2-amino-2-(4-hydroxyphenyl)-acetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo-[3.2.0]heptane-2-carboxylic acid;4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6-[[(2S)-amino(4-hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-, (2S,5R,6R)-;4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6-[[amino(4-hydroxyphenyl)acetyl]amino]-3,3-dimethyl-7-oxo-, [2S-[2α,5α,6β(R*)]]-;4-Thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid, 6-[2-amino-2-(p-hydroxyphenyl)acetamido]-3,3-dimethyl-7-oxo-, stereoisomer (8CI);Amoxicillin Related Compound B (15 mg) (L-amoxicillin);AMoxicillin Related CoMpound B;Amoxicillin trihydrate impurity B | | CAS: | 26889-93-0 | | MF: | C16H19N3O5S | | MW: | 365.4 | | EINECS: | | | Product Categories: | Chiral Reagents, Pharmaceuticals, Intermediates & Fine Chemicals, Sulfur & Selenium Compounds | | Mol File: | 26889-93-0.mol |  |
| | L-Amoxicillin Chemical Properties |
| Boiling point | 743.2±60.0 °C(Predicted) | | density | 1.54±0.1 g/cm3(Predicted) | | storage temp. | Hygroscopic, -20°C Freezer, Under inert atmosphere | | solubility | DMSO (Slightly), Water (Slightly, Heated, Sonicated) | | pka | 2.44±0.50(Predicted) | | form | Solid | | color | White to Off-White | | InChI | 1S/C16H19N3O5S/c1-16(2)11(15(23)24)19-13(22)10(14(19)25-16)18-12(21)9(17)7-3-5-8(20)6-4-7/h3-6,9-11,14,20H,17H2,1-2H3,(H,18,21)(H,23,24)/t9-,10+,11-,14+/m0/s1 | | InChIKey | LSQZJLSUYDQPKJ-BBGACYKPSA-N | | SMILES | S1[C@H]2N([C@H](C1(C)C)C(=O)[O-])C(=O)[C@H]2NC(=O)[C@@H]([N+H3])c3ccc(cc3)O |
| WGK Germany | WGK 3 | | HS Code | 2934990002 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Resp. Sens. 1 Skin Sens. 1 |
| | L-Amoxicillin Usage And Synthesis |
| Uses | Isomer of Amoxicillin (A634235), a semi-synthetic antibiotic related to penicillin. Antibacterial. | | Uses | L-Amoxicillin (Amoxicillin EP Impurity B) is an isomer of Amoxicillin (A634235), a semi-synthetic antibiotic related to penicillin. | | Definition | ChEBI: (2S,5R,6R)-6-[[(2S)-2-amino-2-(4-hydroxyphenyl)-1-oxoethyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid is a penicillin. |
| | L-Amoxicillin Preparation Products And Raw materials |
|