- Daphnoretin
-
- $50.00
-
2026-04-22
- CAS:2034-69-7
- Purity: 99.85%
- Supply Ability: 10g
- daphnoretin
-
-
2026-02-02
- CAS:2034-69-7
- Min. Order: 5mg
- Purity: 99%HPLC
- Supply Ability: 2000tons
- Daphnoretin
-
-
2023-02-24
- CAS:2034-69-7
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | daphnoretin Basic information |
| Product Name: | daphnoretin | | Synonyms: | Coumarin, 7-hydroxy-6-methoxy-3,7'-oxydi-;7-Hydroxy-6-methoxy-3-[(2-oxo-2H-1-benzopyran 7-yl)-oxy]-2H-1-benzopyran-2-one;Thymerol;Daphnoretin ,98%;2H-1-Benzopyran-2-one,7-hydroxy-6-methoxy-3-[(2-oxo-2H-1-benzopyran-7-yl)oxy]-;aphnoretin;7-hydroxy-6-methoxy-3-(2-oxochromen-7-yl)oxychromen-2-one;7-Hydroxy-6-methoxy-3-[(2-oxo-2H-chromen-7-yl)oxy]-2H-chrome... | | CAS: | 2034-69-7 | | MF: | C19H12O7 | | MW: | 352.29 | | EINECS: | | | Product Categories: | Coumarins | | Mol File: | 2034-69-7.mol |  |
| | daphnoretin Chemical Properties |
| Melting point | 245-246℃ | | Boiling point | 639.6±55.0 °C(Predicted) | | density | 1.501 | | storage temp. | 2-8°C | | solubility | DMSO:100.0(Max Conc. mg/mL);283.85(Max Conc. mM) | | form | A crystalline solid | | pka | 7.53±0.20(Predicted) | | color | Off-white to light yellow | | Major Application | food and beverages | | InChI | 1S/C19H12O7/c1-23-16-6-11-7-17(19(22)26-15(11)9-13(16)20)24-12-4-2-10-3-5-18(21)25-14(10)8-12/h2-9,20H,1H3 | | InChIKey | JRHMMVBOTXEHGJ-UHFFFAOYSA-N | | SMILES | [o]1c2c(cc([c]1=O)Oc3cc4[o][c](ccc4cc3)=O)cc(c(c2)O)OC |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | daphnoretin Usage And Synthesis |
| Chemical Properties | Yellow powder, soluble in methanol and ethanol, poorly soluble in chloroform, ether and acetone, derived from King Lao. | | Uses | Daphnoretin is an active constituent of Wikstroemia indica C. A. Meys which possesses anti-cancer activity. Inhibitory effect on mitosis. | | Definition | ChEBI: A member of the class of coumarins that is coumarin substituted by a hydroxy group at position 7, a methoxy group at position 6 and a (2-oxo-2H-chromen-7-yl)oxy group at position 3. |
| | daphnoretin Preparation Products And Raw materials |
|