9-(β-D-Xylofuranosyl)adenine manufacturers
|
| | 9-(β-D-Xylofuranosyl)adenine Basic information |
| Product Name: | 9-(β-D-Xylofuranosyl)adenine | | Synonyms: | 9-.beta.-D-Xylofuranosyladenine;9H-Purin-6-amine, 9-.beta.-D-xylofuranosyl-;Adenine xyloside;Adenine, 9-.beta.-D-xylofuranosyl-;Nsc 7359;Nsc7359;Xylosyl a;Xylosyladenine | | CAS: | 524-69-6 | | MF: | C10H13N5O4 | | MW: | 267.24 | | EINECS: | | | Product Categories: | | | Mol File: | 524-69-6.mol |  |
| | 9-(β-D-Xylofuranosyl)adenine Chemical Properties |
| Melting point | 125-140 °C | | Boiling point | 676.3±65.0 °C(Predicted) | | density | 2.08±0.1 g/cm3(Predicted) | | pka | 13.11±0.70(Predicted) | | form | Solid | | color | White to off-white | | InChI | InChI=1S/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13) | | InChIKey | OIRDTQYFTABQOQ-UHFFFAOYSA-N | | SMILES | O1C(CO)C(O)C(O)C1N1C2=C(N=C1)C(N)=NC=N2 |
| | 9-(β-D-Xylofuranosyl)adenine Usage And Synthesis |
| Uses | 9-(β-d-Xylofuranosyl)adenine (xylo-A) was synthesized long ago and found to be effective in prolonging the survival time of mice bearing TA3 or Ehrlich ascites tumours. It is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. 9-(β-d-Arabinofuranosyl)adenine (vidarabine), which was reported to have similar antitumour properties to xylo-A, is now being used clinically as an antiviral agent[1]. | | Definition | ChEBI: A purine nucleoside in which adenine is attached to xylofuranose via a beta-N9-glycosidic bond. | | References | [1] Yutaka Kubota. “Synthesis and antiviral evaluation of 4’-alkoxy analogues of 9-(beta-D-xylofuranosyl)adenine.” Antiviral Chemistry and Chemotherapy 19 5 (2009): 201–12.
|
| | 9-(β-D-Xylofuranosyl)adenine Preparation Products And Raw materials |
|