|
|
| | 2-Bromo-4-(trifluoromethyl)aniline Basic information |
| | 2-Bromo-4-(trifluoromethyl)aniline Chemical Properties |
| Melting point | 26-28°C | | Boiling point | 109-110 °C10 mm Hg(lit.) | | density | 1,7 g/cm3 | | refractive index | n20/D 1.524(lit.) | | Fp | 110 °C | | storage temp. | Keep in dark place,Sealed in dry,Room Temperature | | form | Crystals | | pka | 0.70±0.10(Predicted) | | color | White | | BRN | 8139978 | | InChI | InChI=1S/C7H5BrF3N/c8-5-3-4(7(9,10)11)1-2-6(5)12/h1-3H,12H2 | | InChIKey | QKRJIXSZTKOFTD-UHFFFAOYSA-N | | SMILES | C1(N)=CC=C(C(F)(F)F)C=C1Br | | CAS DataBase Reference | 57946-63-1(CAS DataBase Reference) | | NIST Chemistry Reference | Benzenamine, 2-bromo-4-(trifluoromethyl)-(57946-63-1) |
| Hazard Codes | Xi,Xn | | Risk Statements | 36/37/38-20/21/22 | | Safety Statements | 26-36-36/37/39 | | RIDADR | 2810 | | WGK Germany | 3 | | Hazard Note | Irritant | | HazardClass | 6.1 | | HS Code | 29214990 | | Storage Class | 10 - Combustible liquids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 2-Bromo-4-(trifluoromethyl)aniline Usage And Synthesis |
| Chemical Properties | white crystals | | Uses | 2-Bromo-4-(trifluoromethyl)aniline is mainly used as a raw material for organic synthesis or a reagent for chemical reactions, and can be used to prepare 2-Amino-5-trifluoromethylbenzonitrile and 2-Bromo-1-nitro-4-(trifluoromethyl) benzene among other organic heterocyclic compounds. | | Synthesis | 2-Bromo-4-(trifluoromethyl)aniline is prepared by reacting 4-(trifluoromethyl)aniline with N-bromosuccinimide in dichloromethane. The following is the reaction procedure: Add 200 mL of distilled CH2Cl 2 and 4- (trifluoromethyl) aniline (20 g, 124.13 mmol) to a two neck flask. Slowly dropwise N-bromosuccinimide (24.3 g, 136.5 mmol) dissolved in CH2Cl2. When the reaction is complete, extract with CH2Cl2. Purification by column separation (EA: Hx = 1: 4) (yield: 50percent)
 | | References | [1] Journal of Organic Chemistry, 2018, vol. 83, # 2, p. 930 - 938 [2] Patent: KR2018/50795, 2018, A. Location in patent: Paragraph 0086; 0087; 0104-0106 [3] Patent: US3946025, 1976, A [4] Chinese Journal of Chemistry, 2018, vol. 36, # 9, p. 815 - 818 [5] Patent: US3995042, 1976, A |
| | 2-Bromo-4-(trifluoromethyl)aniline Preparation Products And Raw materials |
|