- Boc-Ser-OtBu
-
-
2022-01-04
- CAS:7738-22-9
- Min. Order: 1g
- Purity: 98%min
- Supply Ability: 100kgs/month
- BOC-SER(TBU)-OH
-
- $1.00
-
2019-07-06
- CAS:7738-22-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 20kg
- BOC-SER(TBU)-OH
-
- $1.00
-
2019-07-06
- CAS:7738-22-9
- Min. Order: 1KG
- Purity: 99%
- Supply Ability: 1000KG
|
| | Boc-L-serine tert-butyl ester Basic information |
| Product Name: | Boc-L-serine tert-butyl ester | | Synonyms: | BOC-O-T-BUTYL-L-SERINE;BOC-SER(BU)-OH;BOC-SER(BUT)-OH;BOC-SER-OTBU;BOC-SERINE(TBU)-OH;N-ALPHA-TERT-BUTYLOXYCARBONYL-O-TERT-BUTYL-L-SERINE;N-ALPHA-T-BUTOXYCARBONYL-O-T-BUTYL-L-SERINE;N-(tert-Butoxycarbonyl)-L-serine tert-butylester | | CAS: | 7738-22-9 | | MF: | C12H23NO5 | | MW: | 261.31 | | EINECS: | | | Product Categories: | | | Mol File: | 7738-22-9.mol |  |
| | Boc-L-serine tert-butyl ester Chemical Properties |
| Melting point | 80℃ | | Boiling point | 381.9±32.0 °C(Predicted) | | density | 1.087±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | form | Solid | | pka | 10.70±0.46(Predicted) | | color | White to off-white | | InChI | InChI=1S/C12H23NO5/c1-11(2,3)17-9(15)8(7-14)13-10(16)18-12(4,5)6/h8,14H,7H2,1-6H3,(H,13,16)/t8-/m0/s1 | | InChIKey | NSNZHQVMWJPBPI-QMMMGPOBSA-N | | SMILES | C(OC(C)(C)C)(=O)[C@H](CO)NC(OC(C)(C)C)=O |
| | Boc-L-serine tert-butyl ester Usage And Synthesis |
| Chemical Properties | White solid | | Uses | (S)-tert-Butyl 2-((tert-Butoxycarbonyl)amino)-3-hydroxypropanoate has been used as a reactant in the synthesis of biomembrane-mimic polymers for tissue engineering or bioimplants. |
| | Boc-L-serine tert-butyl ester Preparation Products And Raw materials |
|