| Company Name: |
Adamas Reagent, Ltd.
|
| Tel: |
400-6009262 15618770481 |
| Email: |
yhx@titansci.com |
| Products Intro: |
Product Name:2-(6-Methyl-4,8-Dioxo-1,3,6,2-Dioxazaborocan-2-Yl)Benzaldehyde CAS:1257651-51-6 Purity:95% Package:1g;5g;25g;100g
|
| Company Name: |
Shanghai Hanhong Scientific Co.,Ltd.
|
| Tel: |
021-54306202 13764082696 |
| Email: |
info@hanhongsci.com |
| Products Intro: |
Product Name:2-Formylphenylboronic acid MIDA ester Remarks:MR01040040
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:2-Formylphenylboronic acid MIDA ester CAS:1257651-51-6 Purity:97% Package:5G Remarks:698210-5G
|
| Company Name: |
Meng Cheng Technology (Shanghai) Co., LTD
|
| Tel: |
400-820-6829 |
| Email: |
sales@mitachieve.com |
| Products Intro: |
Product Name:2-(6-methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzaldehyde CAS:1257651-51-6 Purity:97% Package:5g
|
|
| | 2-(6-Methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzaldehyde Basic information |
| | 2-(6-Methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzaldehyde Chemical Properties |
| Melting point | 224-229 °C | | form | powder | | InChI | 1S/C12H12BNO5/c1-14-6-11(16)18-13(19-12(17)7-14)10-5-3-2-4-9(10)8-15/h2-5,8H,6-7H2,1H3 | | InChIKey | QWSWQNRMPQJHFH-UHFFFAOYSA-N | | SMILES | CN1CC(=O)OB(OC(=O)C1)c2ccccc2C=O |
| Hazard Codes | Xn | | Risk Statements | 22 | | WGK Germany | 3 | | Storage Class | 13 - Non Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 2-(6-Methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzaldehyde Usage And Synthesis |
| | 2-(6-Methyl-4,8-dioxo-1,3,6,2-dioxazaborocan-2-yl)benzaldehyde Preparation Products And Raw materials |
|