|
|
| | Rhodium(II) octanoate dimer Basic information |
| | Rhodium(II) octanoate dimer Chemical Properties |
| Melting point | 289-292°C | | storage temp. | Inert atmosphere,Room Temperature | | solubility | Soluble in hot alcohol, dichloromethane, toluene and acetic acid, slightly soluble in alcohol | | form | Powder | | color | Green | | InChI | InChI=1S/4C8H16O2.2Rh/c4*1-2-3-4-5-6-7-8(9)10;;/h4*2-7H2,1H3,(H,9,10);;/q;;;;2*+2/p-4 | | InChIKey | NTRXCIBAMWRBPL-UHFFFAOYSA-N | | SMILES | C(C1=O[Rh+2]234O=C(CCCCCCC)[O-][Rh+2]2(O=C(CCCCCCC)[O-]3)(O=C(CCCCCCC)[O-]4)[O-]1)CCCCCC |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HS Code | 28439000 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral Aquatic Chronic 4 |
| | Rhodium(II) octanoate dimer Usage And Synthesis |
| Chemical Properties | Green Powder | | Uses | Rhodium(II) Octanoate Dimer is a catalyst which is used in intramolecular cyclization of 1-sulfonyl-1,2,3-triazole and sulfinate. | | Preparation | Rhodium(II) octanoate dimer can be prepared by ligand substitution from Rh2(OAc)4. | | reaction suitability | reaction type: C-H Activation reagent type: catalyst | | storage | air stable, weakly hygroscopic; stored in desiccator |
| | Rhodium(II) octanoate dimer Preparation Products And Raw materials |
|