|
|
| | 1-fluoro-4-isopropylbenzene Basic information |
| Product Name: | 1-fluoro-4-isopropylbenzene | | Synonyms: | 4-FLUOROCUMENE;4-FLUOROISOPROPYLBENZENE;p-fluorocumene;NSC 79875;1-Fluoro-4-(1-methylethyl)benzene;1-fluoro-4-isopropyl-benzene;1-fluoro-4-propan-2-ylbenzene;1-fluoro-4-propan-2-yl-benzene | | CAS: | 403-39-4 | | MF: | C9H11F | | MW: | 138.18 | | EINECS: | 206-957-2 | | Product Categories: | | | Mol File: | 403-39-4.mol |  |
| | 1-fluoro-4-isopropylbenzene Chemical Properties |
| storage temp. | Sealed in dry,Room Temperature | | Appearance | Colorless to light yellow Liquid | | InChI | InChI=1S/C9H11F/c1-7(2)8-3-5-9(10)6-4-8/h3-7H,1-2H3 | | InChIKey | XZISOEPNTDOUEA-UHFFFAOYSA-N | | SMILES | C1(F)=CC=C(C(C)C)C=C1 |
| | 1-fluoro-4-isopropylbenzene Usage And Synthesis |
| Uses |
1-fluoro-4-isopropylbenzene is a fluorine-substituted compound. It could be used as a pharmaceutical intermediate in pharmaceutical synthesis and scientific research.
|
| | 1-fluoro-4-isopropylbenzene Preparation Products And Raw materials |
|