- Dehydrodiisoeugenol
-
-
2023-02-24
- CAS:2680-81-1
- Min. Order: 5mg
- Purity: ≥98%(HPLC)
- Supply Ability: 10 g
|
| | 4-[(2R,3R)-2,3-Dihydro-7-methoxy-3-methyl-5-[(E)-1-propenyl]benzofuran-2-yl]-2-methoxyphenol Basic information |
| Product Name: | 4-[(2R,3R)-2,3-Dihydro-7-methoxy-3-methyl-5-[(E)-1-propenyl]benzofuran-2-yl]-2-methoxyphenol | | Synonyms: | (2R,3R)-2,3-Dihydro-2-(4-hydroxy-3-methoxyphenyl)-5-[(E)-1-propenyl]-3-methyl-7-methoxybenzofuran;2-Methoxy-4-[(2R,3R)-2,3-dihydro-7-methoxy-3-methyl-5-[(E)-1-propenyl]benzofuran-2-yl]phenol;2β-(3-Methoxy-4-hydroxyphenyl)-3α-methyl-5-[(E)-1-propenyl]-7-methoxy-2,3-dihydrobenzofuran;4-[(2R,3R)-2,3-Dihydro-7-methoxy-3-methyl-5-[(E)-1-propenyl]benzofuran-2-yl]-2-methoxyphenol;4-(2,3-Dihydro-7-methoxy-3-methyl-5-propenyl-2-benzofuranyl)-2-methoxyphenol;2-methoxy-4-[7-methoxy-3-methyl-5-[(E)-prop-1-enyl]-2,3-dihydro-1-benzofuran-2-yl]phenol;Dehydrodiisoeugenol, 98%, from Myristica fragrans Houtt.;Phenol, 4-[2,3-dihydro-7-methoxy-3-methyl-5-(1-propen-1-yl)-2-benzofuranyl]-2-methoxy- | | CAS: | 2680-81-1 | | MF: | C20H22O4 | | MW: | 326.39 | | EINECS: | | | Product Categories: | chemical reagent;pharmaceutical intermediate;phytochemical;reference standards from Chinese medicinal herbs (TCM).;standardized herbal extract | | Mol File: | 2680-81-1.mol | ![4-[(2R,3R)-2,3-Dihydro-7-methoxy-3-methyl-5-[(E)-1-propenyl]benzofuran-2-yl]-2-methoxyphenol Structure](CAS/GIF/2680-81-1.gif) |
| | 4-[(2R,3R)-2,3-Dihydro-7-methoxy-3-methyl-5-[(E)-1-propenyl]benzofuran-2-yl]-2-methoxyphenol Chemical Properties |
| Melting point | 133 °C | | Boiling point | 452.0±45.0 °C(Predicted) | | density | 1.160±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C | | solubility | DMSO: ≥ 250 mg/mL (765.95 mM) | | form | powder | | pka | 9.80±0.35(Predicted) | | color | White | | Major Application | food and beverages | | InChI | 1S/C20H22O4/c1-5-6-13-9-15-12(2)19(24-20(15)18(10-13)23-4)14-7-8-16(21)17(11-14)22-3/h5-12,19,21H,1-4H3/b6-5- | | InChIKey | ITDOFWOJEDZPCF-WAYWQWQTSA-N | | SMILES | O1C(C(c3c1c(cc(c3)\C=C/C)OC)C)c2cc(c(cc2)O)OC | | LogP | 4.188 (est) |
| Safety Statements | 24/25 | | WGK Germany | WGK 3 | | HS Code | 29329990 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Dermal
Acute Tox. 4 Oral
Eye Irrit. 2
Skin Irrit. 2
Skin Sens. 1 |
| | 4-[(2R,3R)-2,3-Dihydro-7-methoxy-3-methyl-5-[(E)-1-propenyl]benzofuran-2-yl]-2-methoxyphenol Usage And Synthesis |
| Chemical Properties | White needle-shaped crystals, soluble in methanol, almost insoluble in ether, derived from nutmeg. | | Uses | Dehydrodiisoeugenol is a peroxisome proliferator-activated receptor (PPARS) agonist. An antidiabetic drug. It is an anxiogenic agent in cerebral nucleus of rat. |
| | 4-[(2R,3R)-2,3-Dihydro-7-methoxy-3-methyl-5-[(E)-1-propenyl]benzofuran-2-yl]-2-methoxyphenol Preparation Products And Raw materials |
|