| Company Name: |
BioBioPha Co., Ltd.
|
| Tel: |
0871-65217109 13211707573; |
| Email: |
y.liu@mail.biobiopha.com |
| Products Intro: |
Product Name:Mearnsitrin CAS:30484-88-9 Purity:98.0% Package:5mg Remarks:BBP00173
|
|
| | 2-(4-Methoxy-3,5-dihydroxyphenyl)-3-(6-deoxy-α-L-mannopyranosyloxy)-5,7-dihydroxy-4H-1-benzopyran-4-one Basic information |
| Product Name: | 2-(4-Methoxy-3,5-dihydroxyphenyl)-3-(6-deoxy-α-L-mannopyranosyloxy)-5,7-dihydroxy-4H-1-benzopyran-4-one | | Synonyms: | 2-(4-Methoxy-3,5-dihydroxyphenyl)-3-(6-deoxy-α-L-mannopyranosyloxy)-5,7-dihydroxy-4H-1-benzopyran-4-one;3-[(6-Deoxy-α-L-mannopyranosyl)oxy]-3',5,5',7-tetrahydroxy-4'-methoxyflavone;Mearnsitrin;Mearnsetin 3-rhamnoside;Myricetin 4'-methyl ether-3-O-rhamnoside;4H-1-Benzopyran-4-one, 3-[(6-deoxy-α-L-mannopyranosyl)oxy]-2-(3,5-dihydroxy-4-methoxyphenyl)-5,7-dihydroxy-;Mearnsitrin >=95% (LC/MS-ELSD) | | CAS: | 30484-88-9 | | MF: | C22H22O12 | | MW: | 478.4 | | EINECS: | | | Product Categories: | | | Mol File: | 30484-88-9.mol |  |
| | 2-(4-Methoxy-3,5-dihydroxyphenyl)-3-(6-deoxy-α-L-mannopyranosyloxy)-5,7-dihydroxy-4H-1-benzopyran-4-one Chemical Properties |
| Boiling point | 861.2±65.0 °C(Predicted) | | density | 1.76±0.1 g/cm3(Predicted) | | storage temp. | -20°C | | pka | 6.16±0.40(Predicted) | | form | solid | | Major Application | metabolomics vitamins, nutraceuticals, and natural products | | InChIKey | NAQNISJXKDSYJD-DHWIRCOFSA-N | | SMILES | COc1c(O)cc(cc1O)C2=C(O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](O)[C@H]3O)C(=O)c4c(O)cc(O)cc4O2 |
| WGK Germany | 3 | | Storage Class | 11 - Combustible Solids |
| | 2-(4-Methoxy-3,5-dihydroxyphenyl)-3-(6-deoxy-α-L-mannopyranosyloxy)-5,7-dihydroxy-4H-1-benzopyran-4-one Usage And Synthesis |
| Uses | Mearnsitrin is a flavonoid isolated from the stems of Emilia sonchifolia DC. and is known to be a natural antioxidant. | | Definition | ChEBI: Mearnsitrin is a glycoside and a member of flavonoids. |
| | 2-(4-Methoxy-3,5-dihydroxyphenyl)-3-(6-deoxy-α-L-mannopyranosyloxy)-5,7-dihydroxy-4H-1-benzopyran-4-one Preparation Products And Raw materials |
|