- Nilofabicin
-
- $34.00
-
2026-07-15
- CAS:934628-27-0
- Purity: 98.66%
- Supply Ability: 10g
|
| | 1-(3-AMINO-2-METHYL-BENZYL)-4-(2-THIOPHEN-2-YL-ETHOXY)-2-PYRIDONE Basic information |
| | 1-(3-AMINO-2-METHYL-BENZYL)-4-(2-THIOPHEN-2-YL-ETHOXY)-2-PYRIDONE Chemical Properties |
| Boiling point | 607.1±55.0 °C(Predicted) | | density | 1.27±0.1 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | solubility | DMSO : 100 mg/mL (293.74 mM; Need ultrasonic) | | pka | 4.19±0.10(Predicted) | | form | Solid | | color | White to off-white | | InChI | 1S/C19H20N2O2S/c1-14-15(4-2-6-18(14)20)13-21-9-7-16(12-19(21)22)23-10-8-17-5-3-11-24-17/h2-7,9,11-12H,8,10,13,20H2,1H3 | | InChIKey | YCLREGRRHGLOAK-UHFFFAOYSA-N | | SMILES | [s]1c(ccc1)CCOC2=CC(=O)N(C=C2)Cc3c(c(ccc3)N)C |
| WGK Germany | WGK 3 | | Storage Class | 11 - Combustible Solids |
| | 1-(3-AMINO-2-METHYL-BENZYL)-4-(2-THIOPHEN-2-YL-ETHOXY)-2-PYRIDONE Usage And Synthesis |
| Uses | Nilofabicin is an enoyl-(acyl-carrier protein) reductase (FabI) inhibitor. Nilofabicin had an MIC(90) of 0.5 microg/ml for Staphylococcus aureus strains and was more potent than either linezolid or vancomycin[1]. | | References | [1] Jong Hwa Yum,et, al. In Vitro Activities of CG400549, a Novel FabI Inhibitor, against Recently Isolated Clinical Staphylococcal Strains in Korea. Antimicrob Agents Chemother. 2007 Jul; 51(7): 2591–2593. |
| | 1-(3-AMINO-2-METHYL-BENZYL)-4-(2-THIOPHEN-2-YL-ETHOXY)-2-PYRIDONE Preparation Products And Raw materials |
|