|
|
| | 2-Bromo-5-fluorobenzyl bromide Basic information |
| | 2-Bromo-5-fluorobenzyl bromide Chemical Properties |
| Melting point | 34-35°C | | Boiling point | 89-90°C 1mm | | density | 1.92g/ml | | refractive index | 1.59 | | Fp | 89-90°C/1mm | | storage temp. | 2-8°C | | form | powder to lump | | color | White to Almost white | | Water Solubility | Difficult to mix in water. | | Sensitive | Lachrymatory | | BRN | 4177658 | | InChI | InChI=1S/C7H5Br2F/c8-4-5-3-6(10)1-2-7(5)9/h1-3H,4H2 | | InChIKey | CZLWYKAZAVYQIK-UHFFFAOYSA-N | | SMILES | C1(Br)=CC=C(F)C=C1CBr | | CAS DataBase Reference | 112399-50-5(CAS DataBase Reference) | | NIST Chemistry Reference | 2-Bromo-5-fluorobenzyl bromide(112399-50-5) |
| Hazard Codes | C,Xn | | Risk Statements | 34-36-52-22 | | Safety Statements | 26-36/37/39-45 | | RIDADR | 1759 | | Hazard Note | Corrosive/Lachrymatory | | HazardClass | 8 | | PackingGroup | III | | HS Code | 29039990 |
| Provider | Language |
|
ALFA
| English |
| | 2-Bromo-5-fluorobenzyl bromide Usage And Synthesis |
| Chemical Properties | White to almost white solid | | Uses | It is an important pharmaceutical intermediate. Alkylation of the β-amino ester 1a with 2-bromo-5-fluorobenzyl bromide yields Benzazepines as a white solid after silica gel chromatography. |
| | 2-Bromo-5-fluorobenzyl bromide Preparation Products And Raw materials |
|