|
|
| | 4,6-DIHYDROXY-5-NITROPYRIMIDINE Basic information |
| Product Name: | 4,6-DIHYDROXY-5-NITROPYRIMIDINE | | Synonyms: | TIMTEC-BB SBB004009;5-NITRO-4,6-DIHYDROXY-PYRIMIDINE;5-NITRO-4,6-PYRIMIDINEDIOL;5-NITROPYRIMIDINE-4,6-DIOL;AKOS 91765;4,6-DIHYDROXY-5-NITROPYRIMIDINE;4,6-Dihydroxy-5-nitropyrimidine, min. 95%;4,6-Dihydroxy-5-nitropyrimdine | | CAS: | 2164-83-2 | | MF: | C4H3N3O4 | | MW: | 157.08 | | EINECS: | 218-504-6 | | Product Categories: | Heterocyclic Compounds;Nucleotides and Nucleosides;APIs & Intermediate;Pyrimidine;Bases & Related Reagents;Nucleotides;Pyridines, Pyrimidines, Purines and Pteredines | | Mol File: | 2164-83-2.mol |  |
| | 4,6-DIHYDROXY-5-NITROPYRIMIDINE Chemical Properties |
| Melting point | >300 °C(lit.) | | Boiling point | 281.7°C (rough estimate) | | density | 1.8278 (rough estimate) | | refractive index | 1.5000 (estimate) | | storage temp. | Inert atmosphere,Room Temperature | | pka | 0.94±0.10(Predicted) | | form | Crystalline Powder | | color | Yellow | | BRN | 611622 | | InChI | InChI=1S/C4H3N3O4/c8-3-2(7(10)11)4(9)6-1-5-3/h1H,(H2,5,6,8,9) | | InChIKey | ABTLZAVJDRUDNG-UHFFFAOYSA-N | | SMILES | C1=NC(O)=C([N+]([O-])=O)C(=O)N1 | | CAS DataBase Reference | 2164-83-2(CAS DataBase Reference) | | EPA Substance Registry System | 6-Hydroxy-5-nitro-4(1H)-pyrimidinone (2164-83-2) |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-37/39 | | WGK Germany | 3 | | TSCA | TSCA listed | | HS Code | 29335990 |
| | 4,6-DIHYDROXY-5-NITROPYRIMIDINE Usage And Synthesis |
| Chemical Properties | yellow crystalline powder | | Uses | 4,6-Dihydroxy-5-nitropyrimidine (cas# 2164-83-2) is a compound useful in organic synthesis. |
| | 4,6-DIHYDROXY-5-NITROPYRIMIDINE Preparation Products And Raw materials |
|