|
|
| | 4-chloro-7-fluoro-2-methylquinazoline Basic information |
| | 4-chloro-7-fluoro-2-methylquinazoline Chemical Properties |
| Boiling point | 216℃ | | density | 1.380 | | Fp | 84℃ | | storage temp. | Inert atmosphere,Store in freezer, under -20°C | | form | solid | | Appearance | Light yellow to yellow Solid | | InChI | 1S/C9H6ClFN2/c1-5-12-8-4-6(11)2-3-7(8)9(10)13-5/h2-4H,1H3 | | InChIKey | GYITXAMUKYQIFQ-UHFFFAOYSA-N | | SMILES | ClC1=NC(C)=NC2=CC(F)=CC=C21 |
| HS Code | 2933998090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Acute Tox. 4 Oral |
| | 4-chloro-7-fluoro-2-methylquinazoline Usage And Synthesis |
| | 4-chloro-7-fluoro-2-methylquinazoline Preparation Products And Raw materials |
|