- Amino-PEG8-COOtBu
-
-
2025-06-07
- CAS:756526-06-4
- Min. Order: 250mg
- Purity: >98.00%
- Supply Ability: 250mg
|
| | H2N-PEG8-tBu Basic information |
| Product Name: | H2N-PEG8-tBu | | Synonyms: | Amino-PEG9-t-butyl ester;H2N-PEG8-CH2CH2COOtBu;H2N-PEG8-tBu;27-Amino-4,7,10,13,16,19,22,25-octaoxaheptacosanoic acid 1,1-dimethylethyl ester;Amino-PEG8-COOtBu;NH2-PEG8-t-butyl ester,Amino-PEG8-t-butyl ester;4,7,10,13,16,19,22,25-Octaoxaheptacosanoic acid, 27-amino-, 1,1-dimethylethyl ester;amino-dPEG8.(TM).-t-butyl ester | | CAS: | 756526-06-4 | | MF: | C23H47NO10 | | MW: | 497.62 | | EINECS: | | | Product Categories: | peg;Linker | | Mol File: | 756526-06-4.mol |  |
| | H2N-PEG8-tBu Chemical Properties |
| Boiling point | 544.3±45.0 °C(Predicted) | | density | 1.067±0.06 g/cm3(Predicted) | | storage temp. | 2-8°C(protect from light) | | solubility | Soluble in Water, DMSO, DCM, DMF | | form | Oil | | pka | 8.74±0.10(Predicted) | | color | Colorless to light yellow | | InChI | InChI=1S/C23H47NO10/c1-23(2,3)34-22(25)4-6-26-8-10-28-12-14-30-16-18-32-20-21-33-19-17-31-15-13-29-11-9-27-7-5-24/h4-21,24H2,1-3H3 | | InChIKey | UMJVFHNJPJVDSB-UHFFFAOYSA-N | | SMILES | C(OC(C)(C)C)(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCN |
| | H2N-PEG8-tBu Usage And Synthesis |
| Description | Amino-PEG8-t-butyl ester is a monodisperse PEG linker containing an amino group with a t-butyl protected carboxyl group.The amino group is reactive with carboxylic acids, activated NHS esters, carbonyls (ketone, aldehyde) etc. The t-butyl protected carboxyl group can be deprotected under acidic conditions. | | Uses | H2N-PEG8-tBu is a cleavable 8-unit PEG-ADC linker for antibody drug conjugate (ADC) synthesis. | | IC 50 | Cleavable Linker; Alkyl/ether; PEGs |
| | H2N-PEG8-tBu Preparation Products And Raw materials |
|