| Company Name: |
J & K SCIENTIFIC LTD.
|
| Tel: |
18210857532 18210857532 |
| Email: |
jkinfo@jkchemical.com |
| Products Intro: |
Product Name:6-(2-Chloroacetyl)-2H-1,4-benzoxazin-3(4H)-one CAS:26518-76-3 Purity:>95% Package:5g, 500mg, 1g
|
|
| | 6-(CHLOROACETYL)-2H-1,4-BENZOXAZIN-3(4H)-ONE Basic information |
| Product Name: | 6-(CHLOROACETYL)-2H-1,4-BENZOXAZIN-3(4H)-ONE | | Synonyms: | 6-(2-Chloroacetyl)-2h-benzo[1,4]oxazin-3-one;TIMTEC-BB SBB003321;6-(Chloroacetyl)-2H-1,4-benzoxazin-3(4H)-one;6-(CHLOROACETYL)-2H-1,4-BENZOXAZIN-3(4H)-ONE;6-(2-CHLOROACETYL)-2H-1,4-BENZOXAZIN-3(4H)-ONE;6-(2-CHLOROACETYL)-2H-BENZO[B][1,4]OXAZIN-3(4H)-ONE;2H-1,4-Benzoxazin-3(4H)-one,6-(2-chloroacetyl)-;JR-8121, 6-(2-Chloroacetyl)-2H-benzo[b][1,4]oxazin-3(4H)-one, 97% | | CAS: | 26518-76-3 | | MF: | C10H8ClNO3 | | MW: | 225.63 | | EINECS: | | | Product Categories: | Benzoxazines;BenzoxazinesHeterocyclic Building Blocks;Building Blocks;Halogenated Heterocycles;Heterocyclic Building Blocks | | Mol File: | 26518-76-3.mol |  |
| | 6-(CHLOROACETYL)-2H-1,4-BENZOXAZIN-3(4H)-ONE Chemical Properties |
| Melting point | 228-230 °C(lit.) | | Boiling point | 472.9±45.0 °C(Predicted) | | density | 1.386 | | pka | 11.93±0.20(Predicted) | | form | powder to crystal | | color | White to Light yellow | | InChI | 1S/C10H8ClNO3/c11-4-8(13)6-1-2-9-7(3-6)12-10(14)5-15-9/h1-3H,4-5H2,(H,12,14) | | InChIKey | MIAHXWVABDHISZ-UHFFFAOYSA-N | | SMILES | ClCC(=O)c1ccc2OCC(=O)Nc2c1 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | WGK Germany | 3 | | HazardClass | IRRITANT | | HS Code | 2934999090 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | 6-(CHLOROACETYL)-2H-1,4-BENZOXAZIN-3(4H)-ONE Usage And Synthesis |
| Uses | 6-(Chloroacetyl)-2H-1,4-benzoxazin-3(4H)-one may be used in the preparation of [2-(3-oxo-3,4-dihydro-2H-benzo[1,4]oxazin-6-carbonyl)-1H-indol-3-yl]acetic acids and N-alkyl 6-[2-(4,6-diphenylpyridyl)]-2H-[1,4]benzoxazin-3-one. | | General Description | 6-(Chloroacetyl)-2H-1,4-benzoxazin-3(4H)-one is a heterocyclic building block. |
| | 6-(CHLOROACETYL)-2H-1,4-BENZOXAZIN-3(4H)-ONE Preparation Products And Raw materials |
|