| Company Name: |
VDL ORGANICS PVT LTD
|
| Tel: |
+91-9246335727 +91-8328068806 |
| Email: |
info@vdlorganics.com |
| Products Intro: |
Product Name:(R)-2-(((tert-
Butyldimethylsilyl)-oxy) diphenylmethyl) pyrrolidine Purity:98% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
| Company Name: |
SPD CHEMICALS
|
| Tel: |
+91-7075800742 |
| Email: |
sujana@spdchemicals.com |
| Products Intro: |
Product Name:(R)-2-(((tert Butyldimethylsilyl)-oxy) diphenylmethyl) pyrrolidine Purity:99% Package:1 kg,5 kg, 10 kg,25kg and 1 MT
|
|
| | R-2-[[[(1,1-diMethylethyl)diMethylsilyl]oxy]
diphenylMethyl]-Pyrrolidine Basic information |
| Product Name: | R-2-[[[(1,1-diMethylethyl)diMethylsilyl]oxy]
diphenylMethyl]-Pyrrolidine | | Synonyms: | R-2-[[[(1,1-diMethylethyl)diMethylsilyl]oxy]
diphenylMethyl]-Pyrrolidine;R-2-[[[(1,1-DIMETHYLETHYL)DIMETHYLSILYL]OXY]DIPHENYLMETHYL]-PYRROLIDINE;(R)-(+)-α,α-Diphenyl-2-pyrrolidineMethanol tert-butyldiMethylsilyl ether >=97% (HPLC);(R)-(+)-α,α-Diphenyl-2-pyrrolidinemethanol tert-butyldimethylsilyl ether;(R)-2-[(tert-Butyldimethylsiloxy)diphenylmethyl]pyrrolidine;(R)-Diphenylprolinol tert-butyldimethylsilyl ether;(2R)-2-[[[(1,1-Dimethylethyl)dimethylsilyl]oxy]diphenylmethyl]pyrrolidine;Pyrrolidine, 2-[[[(1,1-dimethylethyl)dimethylsilyl]oxy]diphenylmethyl]-, (2R)- | | CAS: | 1236033-34-3 | | MF: | C23H33NOSi | | MW: | 367.6 | | EINECS: | | | Product Categories: | | | Mol File: | 1236033-34-3.mol | ![R-2-[[[(1,1-diMethylethyl)diMethylsilyl]oxy]
diphenylMethyl]-Pyrrolidine Structure](CAS/GIF/1236033-34-3.gif) |
| | R-2-[[[(1,1-diMethylethyl)diMethylsilyl]oxy]
diphenylMethyl]-Pyrrolidine Chemical Properties |
| Boiling point | 445.2±35.0 °C(Predicted) | | density | 0.998±0.06 g/cm3(Predicted) | | pka | 10.12±0.10(Predicted) | | form | crystals | | InChI | 1S/C23H33NOSi/c1-22(2,3)26(4,5)25-23(21-17-12-18-24-21,19-13-8-6-9-14-19)20-15-10-7-11-16-20/h6-11,13-16,21,24H,12,17-18H2,1-5H3/t21-/m1/s1 | | InChIKey | YJFSFDYMOMREQP-OAQYLSRUSA-N | | SMILES | CC(C)(C)[Si](C)(C)OC([C@H]1CCCN1)(c2ccccc2)c3ccccc3 |
| Hazard Codes | Xi | | Risk Statements | 36/37/38 | | Safety Statements | 26 | | WGK Germany | 3 | | Storage Class | 11 - Combustible Solids | | Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| | R-2-[[[(1,1-diMethylethyl)diMethylsilyl]oxy]
diphenylMethyl]-Pyrrolidine Usage And Synthesis |
| | R-2-[[[(1,1-diMethylethyl)diMethylsilyl]oxy]
diphenylMethyl]-Pyrrolidine Preparation Products And Raw materials |
|