| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Email: |
orderCN@merckgroup.com |
| Products Intro: |
Product Name:9-Methyl-9H-fluorene-9-carbonyl chloride
CAS:82102-37-2
Purity:>=99.0% (GC) Package:5G Remarks:745022-5G
|
| Company Name: |
Nanjing Shizhou Biology Technology Co.,Ltd
|
| Tel: |
025-85563444 18351873721 |
| Email: |
purchase@synzest.com |
| Products Intro: |
Product Name:9-Methylfluorene-9-carbonyl chloride
CAS:82102-37-2
Purity:95%HPLC Package:1g;5g
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Email: |
marketing@energy-chemical.com |
| Products Intro: |
Product Name:9-Methyl-9H-fluorene-9-carbonyl chloride >=99.0% (GC)
CAS:82102-37-2
Purity:>=99.0% (GC) Package:25g;5g Remarks:NULL
|
| Company Name: |
Shaoyuan Technology (Shanghai) Co., Ltd.
|
| Tel: |
021-50795510 4000665055 |
| Email: |
marketing@accelachem.com |
| Products Intro: |
Product Name:9-Methyl-9H-fluorene-9-carbonyl Chloride
CAS:82102-37-2
Purity:>=95% Package:1g Remarks:0
|
|
| | 9-Methylfluorene-9-carbonyl chloride Basic information |
| Product Name: | 9-Methylfluorene-9-carbonyl chloride | | Synonyms: | 9-Methylfluorene-9-carbonyl chloride;9H-Fluorene-9-carbonyl chloride, 9-methyl-;9-Methyl-9H-fluorene-9-carbonyl chloride >=99.0% (GC);9-Methyl-9H-fluorene-9-carbonyl chloride;9-Methyl-9H-fluorene-9-carbonyl chloride;COgen | | CAS: | 82102-37-2 | | MF: | C15H11ClO | | MW: | 242.7 | | EINECS: | | | Product Categories: | | | Mol File: | 82102-37-2.mol |  |
| | 9-Methylfluorene-9-carbonyl chloride Chemical Properties |
| Fp | >110℃ | | form | solid | | BRN | 5266487 | | InChI | 1S/C15H11ClO/c1-15(14(16)17)12-8-4-2-6-10(12)11-7-3-5-9-13(11)15/h2-9H,1H3 | | InChIKey | ZQYOOHGEBHBNTP-UHFFFAOYSA-N | | SMILES | CC1(C(Cl)=O)c2ccccc2-c3ccccc13 |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-36/37/39-45 | | RIDADR | UN 3261 8 / PGII | | WGK Germany | 3 | | Storage Class | 8A - Combustible corrosive hazardous materials | | Hazard Classifications | Eye Dam. 1
Skin Corr. 1B |
| | 9-Methylfluorene-9-carbonyl chloride Usage And Synthesis |
| Uses | COGen is a simple alternative for carbon monoxide generation in the application of palladium-catalyzed carbonylation reactions. This reagent has proved to be applicable in a wide range of applications and is compatible with several building blocks in the formation of ketones, amides, esters, etc.
For more information please visit: Technology Spotlight, Professor Skrystrup PPP | | reaction suitability | reaction type: C-C Bond Formation |
| | 9-Methylfluorene-9-carbonyl chloride Preparation Products And Raw materials |
|