Acetic acid, 2-[2-[2-[4-[(4- chlorophenyl)phenylMethyl]-1-piperazinyl]ethoxy]ethoxy]- manufacturers
|
| | Acetic acid, 2-[2-[2-[4-[(4- chlorophenyl)phenylMethyl]-1-piperazinyl]ethoxy]ethoxy]- Basic information |
| Product Name: | Acetic acid, 2-[2-[2-[4-[(4- chlorophenyl)phenylMethyl]-1-piperazinyl]ethoxy]ethoxy]- | | Synonyms: | Cetirizine Impurity E Sodium Salt;Cetirizine Impurity E :[2-(2-{4-[(4-Chlorophenyl)(phenyl)methyl]-1-piperazinyl}ethoxy)et hoxy]acetic acid;Cetirizine Impurity 13(Cetirizine EP Impurity E);Cetirizine -EP-Imp-E;[2-(2-{4-[(4-Chlorophenyl)(phenyl)methyl]-1-piperazinyl}ethoxy)et hoxy]acetic acid;(R)-2-(2-(2-(4-((4-chlorophenyl);Cetirizine Impurity 13 Monomer(Cetirizine EP Impurity E Monomer);Hydroxyzine Acetic Acid | | CAS: | 682323-77-9 | | MF: | C23H29ClN2O4 | | MW: | 432.94 | | EINECS: | | | Product Categories: | ZY | | Mol File: | 682323-77-9.mol | ![Acetic acid, 2-[2-[2-[4-[(4- chlorophenyl)phenylMethyl]-1-piperazinyl]ethoxy]ethoxy]- Structure](CAS/20150408/GIF/682323-77-9.gif) |
| | Acetic acid, 2-[2-[2-[4-[(4- chlorophenyl)phenylMethyl]-1-piperazinyl]ethoxy]ethoxy]- Chemical Properties |
| Boiling point | 578.3±45.0 °C(Predicted) | | density | 1.224±0.06 g/cm3(Predicted) | | storage temp. | Storage temp. 2-8°C | | solubility | DMSO (Slightly), Methanol (Slightly) | | form | Solid | | pka | 3.40±0.10(Predicted) | | color | White to Pale Beige | | InChI | InChI=1S/C23H29ClN2O4/c24-21-8-6-20(7-9-21)23(19-4-2-1-3-5-19)26-12-10-25(11-13-26)14-15-29-16-17-30-18-22(27)28/h1-9,23H,10-18H2,(H,27,28) | | InChIKey | AIOFDOGAYXDHHG-UHFFFAOYSA-N | | SMILES | C(O)(=O)COCCOCCN1CCN(C(C2=CC=C(Cl)C=C2)C2=CC=CC=C2)CC1 |
| | Acetic acid, 2-[2-[2-[4-[(4- chlorophenyl)phenylMethyl]-1-piperazinyl]ethoxy]ethoxy]- Usage And Synthesis |
| Uses | Hydroxyzine Acetic Acid is an Cetirizine (C281100) impurity. The compound has in particular an antiallergic, spasmolytic and antihistaminic activity. |
| | Acetic acid, 2-[2-[2-[4-[(4- chlorophenyl)phenylMethyl]-1-piperazinyl]ethoxy]ethoxy]- Preparation Products And Raw materials |
|