|
|
| | 6-Chloro-3-trifluoromethylpyridin-4-ylamine Basic information | | Uses |
| Product Name: | 6-Chloro-3-trifluoromethylpyridin-4-ylamine | | Synonyms: | 6-Chloro-3-trifluoromethylpyridin-4-ylamine;2-Chloro-5-Trifluoromethyl-Pyridin-4-Ylamine;4-Amino-2-chloro-5-(trifluoromethyl)pyridine;2-Chloro-5-(trifluoromethyl)-4-pyridinamine;4-Pyridinamine, 2-chloro-5-(trifluoromethyl)-;2-Chloro-5-(trifluoromethyl)pyridin-4-amine | | CAS: | 1061358-78-8 | | MF: | C6H4ClF3N2 | | MW: | 196.56 | | EINECS: | | | Product Categories: | | | Mol File: | 1061358-78-8.mol |  |
| | 6-Chloro-3-trifluoromethylpyridin-4-ylamine Chemical Properties |
| Boiling point | 287.3±35.0 °C(Predicted) | | density | 1.507±0.06 g/cm3(Predicted) | | storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C | | pka | 2.48±0.42(Predicted) | | Appearance | White to off-white Solid | | InChI | InChI=1S/C6H4ClF3N2/c7-5-1-4(11)3(2-12-5)6(8,9)10/h1-2H,(H2,11,12) | | InChIKey | BVKYVDJDCQLPEC-UHFFFAOYSA-N | | SMILES | C1(Cl)=NC=C(C(F)(F)F)C(N)=C1 |
| | 6-Chloro-3-trifluoromethylpyridin-4-ylamine Usage And Synthesis |
| Uses | 2-chloro-5-(trifluoromethyl)pyridin-4-amine is a useful research chemical for organic synthesis and other chemical processes. |
| | 6-Chloro-3-trifluoromethylpyridin-4-ylamine Preparation Products And Raw materials |
|