|
|
| | 1-Benzo[b]thien-4-yl-piperazine dihydrochloride Basic information |
| Product Name: | 1-Benzo[b]thien-4-yl-piperazine dihydrochloride | | Synonyms: | 1-Benzo[b]thien-4-yl-piperazine dihydrochloride;1-(Benzo[b]thiophen-4-yl)piperazine dihydrochloride;1-(benzothiophen-4-yl)piperazine;Piperazine, 1-benzo[b]thien-4-yl-, hydrochloride (1:2);1-benzo[b]thien-4-yl-Piperazine hydrochloride (1:2);1-Benzo[b]thiophen-4-yl-piperazine 2HCl | | CAS: | 1677681-05-8 | | MF: | C12H16Cl2N2S | | MW: | 291.23984 | | EINECS: | | | Product Categories: | | | Mol File: | 1677681-05-8.mol | ![1-Benzo[b]thien-4-yl-piperazine dihydrochloride Structure](CAS/20180703/GIF/1677681-05-8.gif) |
| | 1-Benzo[b]thien-4-yl-piperazine dihydrochloride Chemical Properties |
| storage temp. | Inert atmosphere,Room Temperature | | InChI | InChI=1S/C12H14N2S.2ClH/c1-2-11(14-7-5-13-6-8-14)10-4-9-15-12(10)3-1;;/h1-4,9,13H,5-8H2;2*1H | | InChIKey | UNMUGUDMFAWBOP-UHFFFAOYSA-N | | SMILES | N1(C2=C3C=CSC3=CC=C2)CCNCC1.[H]Cl.[H]Cl |
| | 1-Benzo[b]thien-4-yl-piperazine dihydrochloride Usage And Synthesis |
| | 1-Benzo[b]thien-4-yl-piperazine dihydrochloride Preparation Products And Raw materials |
|