|
|
| | 2-FLUORO-6-(TRIFLUOROMETHYL)BENZYLAMINE Basic information |
| Product Name: | 2-FLUORO-6-(TRIFLUOROMETHYL)BENZYLAMINE | | Synonyms: | 2-FLUORO-6-(TRIFLUOROMETHYL)BENZYLAMINE;2-Chloro-6-(trifluoroMethyl)benzylaMine, JRD, 97%;2-(Aminomethyl)-3-fluorobenzotrifluoride, [2-Fluoro-6-(trifluoromethyl)phenyl]methylamine;elagolix intermediate 1;1-[2-Fluoro-6-(trifluoromethyl)phenyl]methanamine;OTF-BYM-6F;RARECHEM AL BW 0538;2-Fluoro-6-(trifluoromethyl)benzenemethanamine | | CAS: | 239087-06-0 | | MF: | C8H7F4N | | MW: | 193.14 | | EINECS: | | | Product Categories: | Amine | | Mol File: | 239087-06-0.mol |  |
| | 2-FLUORO-6-(TRIFLUOROMETHYL)BENZYLAMINE Chemical Properties |
| Boiling point | 173.2±35.0 °C(Predicted) | | density | 1.312±0.06 g/cm3(Predicted) | | refractive index | 1.4925 | | storage temp. | Keep in dark place,Inert atmosphere,2-8°C | | form | liquid | | pka | 7.84±0.10(Predicted) | | color | Clear, colourless | | Sensitive | Air Sensitive | | InChI | InChI=1S/C8H7F4N/c9-7-3-1-2-6(5(7)4-13)8(10,11)12/h1-3H,4,13H2 | | InChIKey | FCYVKQRWNQRCFE-UHFFFAOYSA-N | | SMILES | C1(CN)=C(C(F)(F)F)C=CC=C1F |
| Hazard Codes | C | | Risk Statements | 36/37/38 | | Safety Statements | 26-36 | | Hazard Note | Corrosive/Store under nitrogen | | HazardClass | 8 | | HS Code | 2921490090 |
| | 2-FLUORO-6-(TRIFLUOROMETHYL)BENZYLAMINE Usage And Synthesis |
| Chemical Properties | Colorless to pale yellow liquid | | Uses | (2-Fluoro-6-(trifluoromethyl)phenyl)methanamine Hydrochloride is used in preparation method and application of Elagolix intermediate and its salts. | | Synthesis | In a 5L three-neck flask, Intermediate B (207.0 g, 1.0 mol) was added. Ethanol (500 mL), water (200 mL) and concentrated hydrochloric acid (400 mL) were added sequentially to the reaction system and stirred for 0.5 h. The reaction mixture was cooled to 0-5 °C. Zinc powder (390 g, 6.0 mol) was slowly added while maintaining the temperature at 0-5 °C, and the rate of addition was controlled to ensure that the reaction temperature did not exceed 5 °C. After the addition of zinc powder, the reaction system was warmed up to 80-85 °C and the reaction was maintained at this temperature for 1 hour. Upon completion of the reaction, the mixture was cooled to room temperature, filtered and the filter cake was washed with ethanol (300 mL). The filtrates were combined and concentrated under reduced pressure until a significant amount of solid precipitated. The solid was collected by filtration and dried to give the target product 2-fluoro-6-(trifluoromethyl)benzylamine (169.5 g, 87.8% yield). | | References | [1] Patent: CN107935863, 2018, A. Location in patent: Paragraph 0048-0051; 0055-0056; 0064-0065 |
| | 2-FLUORO-6-(TRIFLUOROMETHYL)BENZYLAMINE Preparation Products And Raw materials |
|