| Company Name: |
Clearsynth Labs Limited
|
| Tel: |
+91-22-26355700 |
| Email: |
info@clearsynth.com |
| Products Intro: |
Product Name:a-1,2,3,4,5,6-Hexachlorocyclohexane-d6 CAS:86194-41-4 Remarks:CS-C-01001
|
| Company Name: |
Shanghai Nafu Biotechnology Co., Ltd.
|
| Tel: |
021-58952328 13125124762 |
| Email: |
sale@chemhui.com |
| Products Intro: |
Product Name:ALPHA-HCH D6 CAS:86194-41-4 Purity:98% Package:1g;5g
|
|
| | ALPHA-HCH D6 Basic information |
| Product Name: | ALPHA-HCH D6 | | Synonyms: | ALPHA-1,2,3,4,5,6-HEXACHLOROCYCLOHEXANE-D6;ALPHA-BHC-D6;ALPHA-HCH D6;α-BHC-d6;α-HCH-d6;α-1,2,3,4,5,6-Hexachlorocyclohexane-D6;Lindan d6;D6-alpha-HCH | | CAS: | 86194-41-4 | | MF: | C6Cl6D6 | | MW: | 296.87 | | EINECS: | | | Product Categories: | | | Mol File: | 86194-41-4.mol |  |
| | ALPHA-HCH D6 Chemical Properties |
| Melting point | 159-160°C | | storage temp. | 0-6°C | | Major Application | agriculture environmental | | InChI | 1S/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H/t1-,2-,3-,4-,5+,6+/m1/s1/i1D,2D,3D,4D,5D,6D | | InChIKey | JLYXXMFPNIAWKQ-NXPQFDGTSA-N | | SMILES | [2H][C@]1(Cl)[C@]([2H])(Cl)[C@]([2H])(Cl)[C@@]([2H])(Cl)[C@@]([2H])(Cl)[C@]1([2H])Cl | | EPA Substance Registry System | Cyclohexane-1,2,3,4,5,6-d6, 1,2,3,4,5,6-hexachloro-, (1.alpha.,2.alpha.,3.beta,4.alpha.,5.beta.,6.beta.)- (86194-41-4) |
| Hazard Codes | T,N | | Risk Statements | 21-25-40-50/53 | | Safety Statements | 22-36/37-45-60-61 | | RIDADR | UN2811 - class 6.1 - PG 3 - MP - RQ - Toxic solids, organic, n.o.s. HI: all | | WGK Germany | 3 | | Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects | | Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Carc. 2 |
| | ALPHA-HCH D6 Usage And Synthesis |
| Uses | agriculture environmental |
| | ALPHA-HCH D6 Preparation Products And Raw materials |
|