MorDalPhos Pd G4 manufacturers
- MorDalPhos Pd G4
-
- $2.00
-
2026-07-02
- CAS:2230788-66-4
- Min. Order: 1kg
- Purity: 99%
- Supply Ability: 100kg
|
| | MorDalPhos Pd G4 Basic information |
| Product Name: | MorDalPhos Pd G4 | | Synonyms: | MorDalPhos Pd G4;Methanesulfonato[2-(diamondophosphine) morpholine][2-(2 '-methylamino-1,1' -biphenyl)] Palladium (II)
(MorDalPhos Pd G4);Methanesulfonato{N-[2-(di-1-adamantylphosphino)phenyl]morpholine}(2'-methylamino-1,1'-biphenyl-2-yl)palladium(II) dichloromethane adduct;Methanesulfonato[2-(diamondophosphine) morpholine][2-(2 '-methylamino-1,1' -biphenyl)] Palladium (II);4-[2-[Bis(tricyclo[3.3.1.13,7]dec-1-yl)phosphino-κP]phenyl]morpholine](methanesulfonato-κO)[2′-(methylamino-κN)[1,1′-biphenyl]-2-yl-κC]palladium;Palladium, [4-[2-[bis(tricyclo[3.3.1.13,7]dec-1-yl)phosphino-κP]phenyl]morpholine](methanesulfonato-κO)[2′-(methylamino-κN)[1,1′-biphenyl]-2-yl-κC]-;4-[2-[Bis(tricyclo[3.3.1.13,7]dec-1-yl)phosphino-κP]phenyl]morpholine](methanesulfonato-κO)[2′-(methylamino-κN)[1,1′-biphenyl]-2-yl-κC]palladium (ACI);MorDalPhos Pd G4 ChemBeads | | CAS: | 2230788-66-4 | | MF: | C44H57N2O4PPdS | | MW: | 847.4 | | EINECS: | | | Product Categories: | | | Mol File: | 2230788-66-4.mol |  |
| | MorDalPhos Pd G4 Chemical Properties |
| storage temp. | 2-8°C, stored under nitrogen | | form | powder | | Appearance | Gray to dark gray Solid | | InChIKey | VWMHZTMMTNRWLL-WPZLEGKQSA-M | | SMILES | CNC1=CC=CC=C1C2=C([Pd]OS(C)(=O)=O)C=CC=C2.COCCNC3=CC=CC=C3P([C@]45C[C@H]6C[C@H](C[C@H](C6)C5)C4)[C@]78C[C@H]9C[C@H](C[C@H](C9)C8)C7 |
| WGK Germany | WGK 3 | | Storage Class | 13 - Non Combustible Solids |
| | MorDalPhos Pd G4 Usage And Synthesis |
| Uses | A powerful ligand for classic cross-coupling reactions combined with the Buchwald Fourth Generation Palladacycle. Bench stable, soluble in most organic solvents. | | reaction suitability | reagent type: catalyst |
| | MorDalPhos Pd G4 Preparation Products And Raw materials |
|