2,3,4-Trifluorobenzyl bromide manufacturers
|
| | 2,3,4-Trifluorobenzyl bromide Basic information |
| Product Name: | 2,3,4-Trifluorobenzyl bromide | | Synonyms: | 2,3,4-TRIFLUOROBENZYL BROMIDE;6-(BROMOMETHYL)-1,2,3-TRIFLUOROBENZENE;ALPHA-BROMO-2,3,4-TRIFLUOROTOLUENE;1-(bromomethyl)-2,3,4-trifluorobenzene;à-bromo-2,3,4-trifluorotoluene;2,3,4-Trifluorobenzyl bromide 97%;2,3,4-Trifluorobenzylbromide97%;Benzene, 1-(bromomethyl)-2,3,4-trifluoro- | | CAS: | 157911-55-2 | | MF: | C7H4BrF3 | | MW: | 225.01 | | EINECS: | 624-279-9 | | Product Categories: | Fluorine series;Aryl;C7;Halogenated Hydrocarbons | | Mol File: | 157911-55-2.mol |  |
| | 2,3,4-Trifluorobenzyl bromide Chemical Properties |
| Boiling point | 191.4±35.0 °C(Predicted) | | density | 1.710 g/mL at 25 °C(lit.) | | refractive index | n20/D 1.5070(lit.) | | Fp | 195 °F | | storage temp. | Inert atmosphere,2-8°C | | form | Liquid | | color | Clear colorless to pale yellow | | Sensitive | Lachrymatory | | BRN | 8762822 | | InChI | InChI=1S/C7H4BrF3/c8-3-4-1-2-5(9)7(11)6(4)10/h1-2H,3H2 | | InChIKey | DGSXDQVPGXFOAN-UHFFFAOYSA-N | | SMILES | C1(CBr)=CC=C(F)C(F)=C1F | | CAS DataBase Reference | 157911-55-2(CAS DataBase Reference) |
| Hazard Codes | C | | Risk Statements | 34 | | Safety Statements | 26-27-36/37/39-45 | | RIDADR | UN 3265 8/PG 2 | | WGK Germany | 3 | | Hazard Note | Corrosive/Lachrymatory | | TSCA | T | | HazardClass | 8 | | PackingGroup | II | | HS Code | 29039990 |
| | 2,3,4-Trifluorobenzyl bromide Usage And Synthesis |
| Chemical Properties | Colorless liquid | | Uses |
2,3,4-Trifluorobenzyl bromide may be used to synthesize phase-transfer catalysts (PTCs).
| | Hazard | 2,3,4-Trifluorobenzyl bromide is a combustible liquid, it causes severe skin burns and eye damage.
|
| | 2,3,4-Trifluorobenzyl bromide Preparation Products And Raw materials |
|