| Company Name: |
Bide Pharmatech Ltd.
|
| Tel: |
400-400-164-7117 18317119277 |
| Email: |
product02@bidepharm.com |
| Products Intro: |
Product Name:2-[5-[1-[6-[[3-(11,12-Didehydrodibenz[b,f]azocin-5(6H)-yl)-3-oxopropyl]amino]-6-oxohexyl]-1,3-dihydro-3,3-dimethyl-5-sulfo-2H-indol-2-ylidene]-1,3-pentadien-1-yl]-3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)-3H-indolium inner salt
CAS:1564286-24-3
Purity:97% Package:5mg;10mg;25mg;50mg;100mg Remarks:BD00844299
|
Cy5 DBCO manufacturers
- triSulfo-Cy5 DBCO
-
-
2025-06-07
- CAS:1564286-24-3
- Min. Order: 25mg
- Purity: >98.00%
- Supply Ability: 25mg
|
| | Cy5 DBCO Basic information |
| Product Name: | Cy5 DBCO | | Synonyms: | Cy5 DBCO;DBCO-Sulfo-Cy5;Cy5-DBCO (Synonyms: DBCO-Sulfo-Cy5);triSulfo-Cy5 DBCO;2-[5-[1-[6-[[3-(11,12-Didehydrodibenz[b,f]azocin-5(6H)-yl)-3-oxopropyl]amino]-6-oxohexyl]-1,3-dihydro-3,3-dimethyl-5-sulfo-2H-indol-2-ylidene]-1,3-pentadien-1-yl]-3,3-dimethyl-5-sulfo-1-(3-sulfopropyl)-3H-indolium inner salt;sulfo Cy5(C3-SO3)-DBCO;Cy5 Azide NHS Ester (CCT-1572);Cy5 DBCO (CCT-A130) | | CAS: | 1564286-24-3 | | MF: | C52H56N4O11S3 | | MW: | 1009.22 | | EINECS: | | | Product Categories: | | | Mol File: | 1564286-24-3.mol |  |
| | Cy5 DBCO Chemical Properties |
| solubility | Soluble in Water, DMSO, DMF, DCM | | form | Solid | | color | Blue to black | | Appearance | Dark blue solid | | ex/em | 649/672 nm (PBS buffer) | | ε(extinction coefficient) | 271000 L?mol?1?cm?1 | | Φ(quantum yield) | 0.28 | | InChIKey | LQHUKJFMCCLWEL-UHFFFAOYSA-N | | SMILES | C([N+]1=C(C(C)(C)C2=CC(S(O)(=O)=O)=CC=C12)C=CC=CC=C1C(C2=CC(S(O)(=O)=O)=CC=C2N1CCCCCC(=O)NCCC(N1CC2=CC=CC=C2C#CC2=CC=CC=C12)=O)(C)C)CCS([O-])(=O)=O |
| | Cy5 DBCO Usage And Synthesis |
| Description | Sulfo-Cy5 DBCO is a water-soluble linker of Cyanine5 fluorophore. DBCO group enables copper free biocompatible Click Chemistry with fast reaction kinetics and good stability. This reagent is compatible to a wide range of standard fluorescent instrumentation such as imagers, plate readers, and microscopes. | | Chemical Properties | Appearance: Dark blue solid
ex/em: 649/672 nm (PBS buffer)
Extinction coefficient (ε): 271000 Lmol1cm1
Quantum yield (Φ): 0.28 | | Uses | DBCO-Sulfo-Cy5, is a Fluorescent dye, that can be used for various labeling applications in chemistry.(Abs/Em = 646/661 nm) | | Abs/Em Maxima | 649/671 nm | | Extinction Coefficient | 250,000 | | Microscopy Laser Line | 633 or 635 nm | | Flow Cytometry Laser Line | 633 or 635 nm | | Spectrally Similar Dyes | Alexa Fluor? 647, CF? 647 Dye, DyLight?649 |
| | Cy5 DBCO Preparation Products And Raw materials |
|